Merge remote-tracking branch 'upstream/develop' into linkify

.gitignore

@@ -5,6 +5,7 @@
 /*.ez
 /test/uploads
 /.elixir_ls
+/test/fixtures/DSCN0010_tmp.jpg
 /test/fixtures/test_tmp.txt
 /test/fixtures/image_tmp.jpg
 /test/tmp/

.gitlab-ci.yml

@@ -58,26 +58,25 @@ unit-testing:
     alias: postgres
     command: ["postgres", "-c", "fsync=off", "-c", "synchronous_commit=off", "-c", "full_page_writes=off"]
   script:
+    - apt-get update && apt-get install -y libimage-exiftool-perl
     - mix deps.get
     - mix ecto.create
     - mix ecto.migrate
     - mix coveralls --preload-modules
 
-# Removed to fix CI issue. In this early state it wasn't adding much value anyway.
+federated-testing:
-# TODO Fix and reinstate federated testing
+  stage: test
-# federated-testing:
+  cache: *testing_cache_policy
-#   stage: test
+  services:
-#   cache: *testing_cache_policy
+  - name: minibikini/postgres-with-rum:12
-#   services:
+    alias: postgres
-#   - name: minibikini/postgres-with-rum:12
+    command: ["postgres", "-c", "fsync=off", "-c", "synchronous_commit=off", "-c", "full_page_writes=off"]
-#     alias: postgres
+  script:
-#     command: ["postgres", "-c", "fsync=off", "-c", "synchronous_commit=off", "-c", "full_page_writes=off"]
+    - mix deps.get
-#   script:
+    - mix ecto.create
-#     - mix deps.get
+    - mix ecto.migrate
-#     - mix ecto.create
+    - epmd -daemon
-#     - mix ecto.migrate
+    - mix test --trace --only federated
-#     - epmd -daemon
-#     - mix test --trace --only federated
 
 unit-testing-rum:
   stage: test
@@ -91,6 +90,7 @@ unit-testing-rum:
     <<: *global_variables
     RUM_ENABLED: "true"
   script:
+    - apt-get update && apt-get install -y libimage-exiftool-perl
     - mix deps.get
     - mix ecto.create
     - mix ecto.migrate

.gitlab/issue_templates/Bug.md

@@ -14,7 +14,7 @@
 * Pleroma version (could be found in the "Version" tab of settings in Pleroma-FE): 
 * Elixir version (`elixir -v` for from source installations, N/A for OTP):
 * Operating system:
-* PostgreSQL version (`postgres -V`):
+* PostgreSQL version (`psql -V`):
 
 
 ### Bug description

CHANGELOG.md

@@ -7,17 +7,29 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 
 ### Changed
 - **Breaking:** Elixir >=1.9 is now required (was >= 1.8)
+- **Breaking:** Configuration: `:auto_linker, :opts` moved to `:pleroma, Pleroma.Formatter`. Old config namespace is deprecated.
 - In Conversations, return only direct messages as `last_status`
 - Using the `only_media` filter on timelines will now exclude reblog media
 - MFR policy to set global expiration for all local Create activities
 - OGP rich media parser merged with TwitterCard
 - Configuration: `:instance, rewrite_policy` moved to `:mrf, policies`, `:instance, :mrf_transparency` moved to `:mrf, :transparency`, `:instance, :mrf_transparency_exclusions` moved to `:mrf, :transparency_exclusions`. Old config namespace is deprecated.
-- **Breaking:** Configuration: `:auto_linker, :opts` moved to `:pleroma, Pleroma.Formatter`. Old config namespace is deprecated.
+- Configuration: `:media_proxy, whitelist` format changed to host with scheme (e.g. `http://example.com` instead of `example.com`). Domain format is deprecated.
 
 <details>
   <summary>API Changes</summary>
 
+- **Breaking:** Pleroma API: The routes to update avatar, banner and background have been removed.
+- **Breaking:** Image description length is limited now.
 - **Breaking:** Emoji API: changed methods and renamed routes.
+- MastodonAPI: Allow removal of avatar, banner and background.
+- Streaming: Repeats of a user's posts will no longer be pushed to the user's stream.
+- Mastodon API: Added `pleroma.metadata.fields_limits` to /api/v1/instance
+- Mastodon API: On deletion, returns the original post text.
+- Mastodon API: Add `pleroma.unread_count` to the Marker entity.
+- **Breaking:** Notification Settings API for suppressing notifications
+  has been simplified down to `block_from_strangers`.
+- **Breaking:** Notification Settings API option for hiding push notification
+  contents has been renamed to `hide_notification_contents`
 </details>
 
 <details>
@@ -33,6 +45,7 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 
 ### Added
 
+- Chats: Added `accepts_chat_messages` field to user, exposed in APIs and federation.
 - Chats: Added support for federated chats. For details, see the docs.
 - ActivityPub: Added support for existing AP ids for instances migrated from Mastodon.
 - Instance: Add `background_image` to configuration and `/api/v1/instance`
@@ -49,14 +62,19 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 - Added `:reject_deletes` group to SimplePolicy
 - MRF (`EmojiStealPolicy`): New MRF Policy which allows to automatically download emojis from remote instances
 - Support pagination in emoji packs API (for packs and for files in pack)
+- Support for viewing instances favicons next to posts and accounts
+- Added Pleroma.Upload.Filter.Exiftool as an alternate EXIF stripping mechanism targeting GPS/location metadata.
 
 <details>
   <summary>API Changes</summary>
+- Mastodon API: Add pleroma.parents_visible field to statuses.
 - Mastodon API: Extended `/api/v1/instance`.
 - Mastodon API: Support for `include_types` in `/api/v1/notifications`.
 - Mastodon API: Added `/api/v1/notifications/:id/dismiss` endpoint.
-- Mastodon API: Add support for filtering replies in public and home timelines
+- Mastodon API: Add support for filtering replies in public and home timelines.
-- Mastodon API: Support for `bot` field in `/api/v1/accounts/update_credentials`
+- Mastodon API: Support for `bot` field in `/api/v1/accounts/update_credentials`.
+- Mastodon API: Support irreversible property for filters.
+- Mastodon API: Add pleroma.favicon field to accounts.
 - Admin API: endpoints for create/update/delete OAuth Apps.
 - Admin API: endpoint for status view.
 - OTP: Add command to reload emoji packs
@@ -70,6 +88,10 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 - Resolving Peertube accounts with Webfinger
 - `blob:` urls not being allowed by connect-src CSP
 - Mastodon API: fix `GET /api/v1/notifications` not returning the full result set
+- Rich Media Previews for Twitter links
+- Admin API: fix `GET /api/pleroma/admin/users/:nickname/credentials` returning 404 when getting the credentials of a remote user while `:instance, :limit_to_local_content` is set to `:unauthenticated`
+- Fix CSP policy generation to include remote Captcha services
+- Fix edge case where MediaProxy truncates media, usually caused when Caddy is serving content for the other Federated instance.
 
 ## [Unreleased (patch)]
 
@@ -211,7 +233,6 @@ The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 - Mastodon API: `pleroma.thread_muted` to the Status entity
 - Mastodon API: Mark the direct conversation as read for the author when they send a new direct message
 - Mastodon API, streaming: Add `pleroma.direct_conversation_id` to the `conversation` stream event payload.
-- Mastodon API: Add `pleroma.unread_count` to the Marker entity
 - Admin API: Render whole status in grouped reports
 - Mastodon API: User timelines will now respect blocks, unless you are getting the user timeline of somebody you blocked (which would be empty otherwise).
 - Mastodon API: Favoriting / Repeating a post multiple times will now return the identical response every time. Before, executing that action twice would return an error ("already favorited") on the second try.

Dockerfile

@@ -33,7 +33,7 @@ ARG DATA=/var/lib/pleroma
 
 RUN echo "http://nl.alpinelinux.org/alpine/latest-stable/community" >> /etc/apk/repositories &&\
 	apk update &&\
-	apk add imagemagick ncurses postgresql-client &&\
+	apk add exiftool imagemagick ncurses postgresql-client &&\
 	adduser --system --shell /bin/false --home ${HOME} pleroma &&\
 	mkdir -p ${DATA}/uploads &&\
 	mkdir -p ${DATA}/static &&\

benchmarks/load_testing/activities.ex

@@ -24,6 +24,7 @@ defmodule Pleroma.LoadTesting.Activities do
   @visibility ~w(public private direct unlisted)
   @types [
     :simple,
+    :simple_filtered,
     :emoji,
     :mentions,
     :hell_thread,
@@ -242,6 +243,15 @@ defmodule Pleroma.LoadTesting.Activities do
     insert_local_activity(visibility, group, users, "Simple status")
   end
 
+  defp insert_activity(:simple_filtered, visibility, group, users, _opts)
+       when group in @remote_groups do
+    insert_remote_activity(visibility, group, users, "Remote status which must be filtered")
+  end
+
+  defp insert_activity(:simple_filtered, visibility, group, users, _opts) do
+    insert_local_activity(visibility, group, users, "Simple status which must be filtered")
+  end
+
   defp insert_activity(:emoji, visibility, group, users, _opts)
        when group in @remote_groups do
     insert_remote_activity(visibility, group, users, "Remote status with emoji :firefox:")

benchmarks/load_testing/fetcher.ex

@@ -32,10 +32,22 @@ defmodule Pleroma.LoadTesting.Fetcher do
     )
   end
 
+  defp create_filter(user) do
+    Pleroma.Filter.create(%Pleroma.Filter{
+      user_id: user.id,
+      phrase: "must be filtered",
+      hide: true
+    })
+  end
+
+  defp delete_filter(filter), do: Repo.delete(filter)
+
   defp fetch_timelines(user) do
     fetch_home_timeline(user)
+    fetch_home_timeline_with_filter(user)
     fetch_direct_timeline(user)
     fetch_public_timeline(user)
+    fetch_public_timeline_with_filter(user)
     fetch_public_timeline(user, :with_blocks)
     fetch_public_timeline(user, :local)
     fetch_public_timeline(user, :tag)
@@ -61,7 +73,7 @@ defmodule Pleroma.LoadTesting.Fetcher do
     }
   end
 
-  defp fetch_home_timeline(user) do
+  defp fetch_home_timeline(user, title_end \\ "") do
     opts = opts_for_home_timeline(user)
 
     recipients = [user.ap_id | User.following(user)]
@@ -84,9 +96,11 @@ defmodule Pleroma.LoadTesting.Fetcher do
       |> Enum.reverse()
       |> List.last()
 
+    title = "home timeline " <> title_end
+
     Benchee.run(
       %{
-        "home timeline" => fn opts -> ActivityPub.fetch_activities(recipients, opts) end
+        title => fn opts -> ActivityPub.fetch_activities(recipients, opts) end
       },
       inputs: %{
         "1 page" => opts,
@@ -108,6 +122,14 @@ defmodule Pleroma.LoadTesting.Fetcher do
     )
   end
 
+  defp fetch_home_timeline_with_filter(user) do
+    {:ok, filter} = create_filter(user)
+
+    fetch_home_timeline(user, "with filters")
+
+    delete_filter(filter)
+  end
+
   defp opts_for_direct_timeline(user) do
     %{
       visibility: "direct",
@@ -210,6 +232,14 @@ defmodule Pleroma.LoadTesting.Fetcher do
     fetch_public_timeline(opts, "public timeline")
   end
 
+  defp fetch_public_timeline_with_filter(user) do
+    {:ok, filter} = create_filter(user)
+    opts = opts_for_public_timeline(user)
+
+    fetch_public_timeline(opts, "public timeline with filters")
+    delete_filter(filter)
+  end
+
   defp fetch_public_timeline(user, :local) do
     opts = opts_for_public_timeline(user, :local)
 

config/config.exs

@@ -97,6 +97,7 @@ config :pleroma, :uri_schemes,
     "dat",
     "dweb",
     "gopher",
+    "hyper",
     "ipfs",
     "ipns",
     "irc",
@@ -171,7 +172,7 @@ config :mime, :types, %{
   "application/ld+json" => ["activity+json"]
 }
 
-config :tesla, adapter: Tesla.Adapter.Hackney
+config :tesla, adapter: Tesla.Adapter.Gun
 
 # Configures http settings, upstream proxy etc.
 config :pleroma, :http,
@@ -188,6 +189,7 @@ config :pleroma, :instance,
   background_image: "/images/city.jpg",
   instance_thumbnail: "/instance/thumbnail.jpeg",
   limit: 5_000,
+  description_limit: 5_000,
   chat_limit: 5_000,
   remote_limit: 100_000,
   upload_limit: 16_000_000,
@@ -434,6 +436,11 @@ config :pleroma, Pleroma.Web.Metadata,
   ],
   unfurl_nsfw: false
 
+config :pleroma, Pleroma.Web.Preload,
+  providers: [
+    Pleroma.Web.Preload.Providers.Instance
+  ]
+
 config :pleroma, :http_security,
   enabled: true,
   sts: false,
@@ -491,8 +498,7 @@ config :pleroma, Pleroma.User,
 
 config :pleroma, Oban,
   repo: Pleroma.Repo,
-  verbose: false,
+  log: false,
-  prune: {:maxlen, 1500},
   queues: [
     activity_expiration: 10,
     federator_incoming: 50,
@@ -506,6 +512,7 @@ config :pleroma, Oban,
     attachments_cleanup: 5,
     new_users_digest: 1
   ],
+  plugins: [Oban.Plugins.Pruner],
   crontab: [
     {"0 0 * * *", Pleroma.Workers.Cron.ClearOauthTokenWorker},
     {"0 * * * *", Pleroma.Workers.Cron.StatsWorker},
@@ -639,32 +646,30 @@ config :pleroma, Pleroma.Repo,
   prepare: :unnamed
 
 config :pleroma, :connections_pool,
-  checkin_timeout: 250,
+  reclaim_multiplier: 0.1,
+  connection_acquisition_wait: 250,
+  connection_acquisition_retries: 5,
   max_connections: 250,
-  retry: 1,
+  max_idle_time: 30_000,
-  retry_timeout: 1000,
+  retry: 0,
   await_up_timeout: 5_000
 
 config :pleroma, :pools,
   federation: [
     size: 50,
-    max_overflow: 10,
+    max_waiting: 10
-    timeout: 150_000
   ],
   media: [
     size: 50,
-    max_overflow: 10,
+    max_waiting: 10
-    timeout: 150_000
   ],
   upload: [
     size: 25,
-    max_overflow: 5,
+    max_waiting: 5
-    timeout: 300_000
   ],
   default: [
     size: 10,
-    max_overflow: 2,
+    max_waiting: 2
-    timeout: 10_000
   ]
 
 config :pleroma, :hackney_pools,
@@ -697,6 +702,8 @@ config :tzdata, :http_client, Pleroma.HTTP.Tzdata
 
 config :ex_aws, http_client: Pleroma.HTTP.ExAws
 
+config :pleroma, :instances_favicons, enabled: false
+
 # Import environment specific config. This must remain at the bottom
 # of this file so it overrides the configuration defined above.
 import_config "#{Mix.env()}.exs"

config/test.exs

@@ -79,8 +79,8 @@ config :web_push_encryption, :http_client, Pleroma.Web.WebPushHttpClientMock
 
 config :pleroma, Oban,
   queues: false,
-  prune: :disabled,
+  crontab: false,
-  crontab: false
+  plugins: false
 
 config :pleroma, Pleroma.ScheduledActivity,
   daily_user_limit: 2,
@@ -111,6 +111,13 @@ config :pleroma, Pleroma.Plugs.RemoteIp, enabled: false
 
 config :pleroma, Pleroma.Web.ApiSpec.CastAndValidate, strict: true
 
+config :pleroma, :instances_favicons, enabled: true
+
+config :pleroma, Pleroma.Uploaders.S3,
+  bucket: nil,
+  streaming_enabled: true,
+  public_endpoint: nil
+
 if File.exists?("./config/test.secret.exs") do
   import_config "test.secret.exs"
 else

docs/API/differences_in_mastoapi_responses.md

@@ -27,6 +27,7 @@ Has these additional fields under the `pleroma` object:
 - `expires_at`: a datetime (iso8601) that states when the post will expire (be deleted automatically), or empty if the post won't expire
 - `thread_muted`: true if the thread the post belongs to is muted
 - `emoji_reactions`: A list with emoji / reaction maps. The format is `{name: "☕", count: 1, me: true}`. Contains no information about the reacting users, for that use the `/statuses/:id/reactions` endpoint.
+- `parent_visible`: If the parent of this post is visible to the user or not.
 
 ## Media Attachments
 
@@ -51,21 +52,27 @@ The `id` parameter can also be the `nickname` of the user. This only works in th
 
 Has these additional fields under the `pleroma` object:
 
+- `ap_id`: nullable URL string, ActivityPub id of the user
+- `background_image`: nullable URL string, background image of the user
 - `tags`: Lists an array of tags for the user
-- `relationship{}`: Includes fields as documented for Mastodon API https://docs.joinmastodon.org/entities/relationship/
+- `relationship` (object): Includes fields as documented for Mastodon API https://docs.joinmastodon.org/entities/relationship/
 - `is_moderator`: boolean, nullable,  true if user is a moderator
 - `is_admin`: boolean, nullable, true if user is an admin
 - `confirmation_pending`: boolean, true if a new user account is waiting on email confirmation to be activated
+- `hide_favorites`: boolean, true when the user has hiding favorites enabled
 - `hide_followers`: boolean, true when the user has follower hiding enabled
 - `hide_follows`: boolean, true when the user has follow hiding enabled
 - `hide_followers_count`: boolean, true when the user has follower stat hiding enabled
 - `hide_follows_count`: boolean, true when the user has follow stat hiding enabled
-- `settings_store`: A generic map of settings for frontends. Opaque to the backend. Only returned in `verify_credentials` and `update_credentials`
+- `settings_store`: A generic map of settings for frontends. Opaque to the backend. Only returned in `/api/v1/accounts/verify_credentials` and `/api/v1/accounts/update_credentials`
-- `chat_token`: The token needed for Pleroma chat. Only returned in `verify_credentials`
+- `chat_token`: The token needed for Pleroma chat. Only returned in `/api/v1/accounts/verify_credentials`
 - `deactivated`: boolean, true when the user is deactivated
 - `allow_following_move`: boolean, true when the user allows automatically follow moved following accounts
 - `unread_conversation_count`: The count of unread conversations. Only returned to the account owner.
 - `unread_notifications_count`: The count of unread notifications. Only returned to the account owner.
+- `notification_settings`: object, can be absent. See `/api/pleroma/notification_settings` for the parameters/keys returned.
+- `accepts_chat_messages`: boolean, but can be null if we don't have that information about a user
+- `favicon`: nullable URL string, Favicon image of the user's instance
 
 ### Source
 
@@ -162,7 +169,7 @@ Returns: array of Status.
 
 The maximum number of statuses is limited to 100 per request.
 
-## PATCH `/api/v1/update_credentials`
+## PATCH `/api/v1/accounts/update_credentials`
 
 Additional parameters can be added to the JSON body/Form data:
 
@@ -177,9 +184,12 @@ Additional parameters can be added to the JSON body/Form data:
 - `pleroma_settings_store` - Opaque user settings to be saved on the backend.
 - `skip_thread_containment` - if true, skip filtering out broken threads
 - `allow_following_move` - if true, allows automatically follow moved following accounts
-- `pleroma_background_image` - sets the background image of the user.
+- `pleroma_background_image` - sets the background image of the user. Can be set to "" (an empty string) to reset.
 - `discoverable` - if true, discovery of this account in search results and other services is allowed.
 - `actor_type` - the type of this account.
+- `accepts_chat_messages` - if false, this account will reject all chat messages.
+
+All images (avatar, banner and background) can be reset to the default by sending an empty string ("") instead of a file.
 
 ### Pleroma Settings Store
 
@@ -187,7 +197,7 @@ Pleroma has mechanism that allows frontends to save blobs of json for each user
 
 The parameter should have a form of `{frontend_name: {...}}`, with `frontend_name` identifying your type of client, e.g. `pleroma_fe`. It will overwrite everything under this property, but will not overwrite other frontend's settings.
 
-This information is returned in the `verify_credentials` endpoint.
+This information is returned in the `/api/v1/accounts/verify_credentials` endpoint.
 
 ## Authentication
 
@@ -215,6 +225,8 @@ Has theses additional parameters (which are the same as in Pleroma-API):
 `GET /api/v1/instance` has additional fields
 
 - `max_toot_chars`: The maximum characters per post
+- `chat_limit`: The maximum characters per chat message
+- `description_limit`: The maximum characters per image description
 - `poll_limits`: The limits of polls
 - `upload_limit`: The maximum upload file size
 - `avatar_upload_limit`: The same for avatars
@@ -223,6 +235,7 @@ Has theses additional parameters (which are the same as in Pleroma-API):
 - `background_image`: A background image that frontends can use
 - `pleroma.metadata.features`: A list of supported features
 - `pleroma.metadata.federation`: The federation restrictions of this instance
+- `pleroma.metadata.fields_limits`: A list of values detailing the length and count limitation for various instance-configurable fields.
 - `vapid_public_key`: The public key needed for push messages
 
 ## Markers
@@ -234,3 +247,43 @@ Has these additional fields under the `pleroma` object:
 ## Streaming
 
 There is an additional `user:pleroma_chat` stream. Incoming chat messages will make the current chat be sent to this `user` stream. The `event` of an incoming chat message is `pleroma:chat_update`. The payload is the updated chat with the incoming chat message in the `last_message` field.
+
+## Not implemented
+
+Pleroma is generally compatible with the Mastodon 2.7.2 API, but some newer features and non-essential features are omitted. These features usually return an HTTP 200 status code, but with an empty response. While they may be added in the future, they are considered low priority.
+
+### Suggestions
+
+*Added in Mastodon 2.4.3*
+
+- `GET /api/v1/suggestions`: Returns an empty array, `[]`
+
+### Trends
+
+*Added in Mastodon 3.0.0*
+
+- `GET /api/v1/trends`: Returns an empty array, `[]`
+
+### Identity proofs
+
+*Added in Mastodon 2.8.0*
+
+- `GET /api/v1/identity_proofs`: Returns an empty array, `[]`
+
+### Endorsements
+
+*Added in Mastodon 2.5.0*
+
+- `GET /api/v1/endorsements`: Returns an empty array, `[]`
+
+### Profile directory
+
+*Added in Mastodon 3.0.0*
+
+- `GET /api/v1/directory`: Returns HTTP 404
+
+### Featured tags
+
+*Added in Mastodon 3.0.0*
+
+- `GET /api/v1/featured_tags`: Returns HTTP 404

docs/API/pleroma_api.md

@@ -287,11 +287,8 @@ See [Admin-API](admin_api.md)
 * Method `PUT`
 * Authentication: required
 * Params:
-    * `followers`: BOOLEAN field, receives notifications from followers
+    * `block_from_strangers`: BOOLEAN field, blocks notifications from accounts you do not follow
-    * `follows`: BOOLEAN field, receives notifications from people the user follows
+    * `hide_notification_contents`: BOOLEAN field. When set to true, it removes the contents of a message from the push notification.
-    * `remote`: BOOLEAN field, receives notifications from people on remote instances
-    * `local`: BOOLEAN field, receives notifications from people on the local instance
-    * `privacy_option`: BOOLEAN field. When set to true, it removes the contents of a message from the push notification.
 * Response: JSON. Returns `{"status": "success"}` if the update was successful, otherwise returns `{"error": "error_msg"}`
 
 ## `/api/pleroma/healthcheck`

docs/administration/CLI_tasks/user.md

@@ -57,11 +57,11 @@ mix pleroma.user invites
 
 ## Revoke invite
 ```sh tab="OTP"
- ./bin/pleroma_ctl user revoke_invite <token_or_id>
+ ./bin/pleroma_ctl user revoke_invite <token>
 ```
 
 ```sh tab="From Source"
-mix pleroma.user revoke_invite <token_or_id>
+mix pleroma.user revoke_invite <token>
 ```
 
 

docs/administration/updating.md

@@ -1,6 +1,6 @@
 # Updating your instance
 
-You should **always check the release notes/changelog** in case there are config deprecations, special update special update steps, etc.
+You should **always check the [release notes/changelog](https://git.pleroma.social/pleroma/pleroma/-/releases)** in case there are config deprecations, special update steps, etc.
 
 Besides that, doing the following is generally enough:
 

docs/configuration/cheatsheet.md

@@ -18,6 +18,7 @@ To add configuration to your config file, you can copy it from the base config.
 * `notify_email`: Email used for notifications.
 * `description`: The instance’s description, can be seen in nodeinfo and ``/api/v1/instance``.
 * `limit`: Posts character limit (CW/Subject included in the counter).
+* `discription_limit`: The character limit for image descriptions.
 * `chat_limit`: Character limit of the instance chat messages.
 * `remote_limit`: Hard character limit beyond which remote posts will be dropped.
 * `upload_limit`: File size limit of uploads (except for avatar, background, banner).
@@ -36,7 +37,7 @@ To add configuration to your config file, you can copy it from the base config.
 * `federation_incoming_replies_max_depth`: Max. depth of reply-to activities fetching on incoming federation, to prevent out-of-memory situations while fetching very long threads. If set to `nil`, threads of any depth will be fetched. Lower this value if you experience out-of-memory crashes.
 * `federation_reachability_timeout_days`: Timeout (in days) of each external federation target being unreachable prior to pausing federating to it.
 * `allow_relay`: Enable Pleroma’s Relay, which makes it possible to follow a whole instance.
-* `public`: Makes the client API in authenticated mode-only except for user-profiles. Useful for disabling the Local Timeline and The Whole Known Network.
+* `public`: Makes the client API in authenticated mode-only except for user-profiles. Useful for disabling the Local Timeline and The Whole Known Network. See also: `restrict_unauthenticated`.
 * `quarantined_instances`: List of ActivityPub instances where private(DMs, followers-only) activities will not be send.
 * `managed_config`: Whenether the config for pleroma-fe is configured in [:frontend_configurations](#frontend_configurations) or in ``static/config.json``.
 * `allowed_post_formats`: MIME-type list of formats allowed to be posted (transformed into HTML).
@@ -154,7 +155,7 @@ config :pleroma, :mrf_user_allowlist, %{
   * `:strip_followers` removes followers from the ActivityPub recipient list, ensuring they won't be delivered to home timelines
   * `:reject` rejects the message entirely
 
-#### mrf_steal_emoji
+#### :mrf_steal_emoji
 * `hosts`: List of hosts to steal emojis from
 * `rejected_shortcodes`: Regex-list of shortcodes to reject
 * `size_limit`: File size limit (in bytes), checked before an emoji is saved to the disk
@@ -251,6 +252,7 @@ This section describe PWA manifest instance-specific values. Currently this opti
 * `background_color`: Describe the background color of the app. (Example: `"#191b22"`, `"aliceblue"`).
 
 ## :emoji
+
 * `shortcode_globs`: Location of custom emoji files. `*` can be used as a wildcard. Example `["/emoji/custom/**/*.png"]`
 * `pack_extensions`: A list of file extensions for emojis, when no emoji.txt for a pack is present. Example `[".png", ".gif"]`
 * `groups`: Emojis are ordered in groups (tags). This is an array of key-value pairs where the key is the groupname and the value the location or array of locations. `*` can be used as a wildcard. Example `[Custom: ["/emoji/*.png", "/emoji/custom/*.png"]]`
@@ -259,10 +261,11 @@ This section describe PWA manifest instance-specific values. Currently this opti
   memory for this amount of seconds multiplied by the number of files.
 
 ## :media_proxy
+
 * `enabled`: Enables proxying of remote media to the instance’s proxy
 * `base_url`: The base URL to access a user-uploaded file. Useful when you want to proxy the media files via another host/CDN fronts.
 * `proxy_opts`: All options defined in `Pleroma.ReverseProxy` documentation, defaults to `[max_body_length: (25*1_048_576)]`.
-* `whitelist`: List of domains to bypass the mediaproxy
+* `whitelist`: List of hosts with scheme to bypass the mediaproxy (e.g. `https://example.com`)
 * `invalidation`: options for remove media from cache after delete object:
   * `enabled`: Enables purge cache
   * `provider`: Which one of  the [purge cache strategy](#purge-cache-strategy) to use.
@@ -277,6 +280,7 @@ Urls of attachments pass to script as arguments.
 * `script_path`: path to external script.
 
 Example:
+
 ```elixir
 config :pleroma, Pleroma.Web.MediaProxy.Invalidation.Script,
   script_path: "./installation/nginx-cache-purge.example"
@@ -444,37 +448,32 @@ For each pool, the options are:
 
 *For `gun` adapter*
 
-Advanced settings for connections pool. Pool with opened connections. These connections can be reused in worker pools.
+Settings for HTTP connection pool.
 
-For big instances it's recommended to increase `config :pleroma, :connections_pool, max_connections: 500` up to 500-1000.
+* `:connection_acquisition_wait` - Timeout to acquire a connection from pool.The total max time is this value multiplied by the number of retries.
-It will increase memory usage, but federation would work faster.
+* `connection_acquisition_retries` - Number of attempts to acquire the connection from the pool if it is overloaded. Each attempt is timed `:connection_acquisition_wait` apart.
-
+* `:max_connections` - Maximum number of connections in the pool.
-* `:checkin_timeout` - timeout to checkin connection from pool. Default: 250ms.
+* `:await_up_timeout` - Timeout to connect to the host.
-* `:max_connections` - maximum number of connections in the pool. Default: 250 connections.
+* `:reclaim_multiplier` - Multiplied by `:max_connections` this will be the maximum number of idle connections that will be reclaimed in case the pool is overloaded.
-* `:retry` - number of retries, while `gun` will try to reconnect if connection goes down. Default: 1.
-* `:retry_timeout` - time between retries when `gun` will try to reconnect in milliseconds. Default: 1000ms.
-* `:await_up_timeout` - timeout while `gun` will wait until connection is up. Default: 5000ms.
 
 ### :pools
 
 *For `gun` adapter*
 
-Advanced settings for workers pools.
+Settings for request pools. These pools are limited on top of `:connections_pool`.
 
 There are four pools used:
 
-* `:federation` for the federation jobs.
+* `:federation` for the federation jobs. You may want this pool's max_connections to be at least equal to the number of federator jobs + retry queue jobs.
-  You may want this pool max_connections to be at least equal to the number of federator jobs + retry queue jobs.
+* `:media` - for rich media, media proxy.
-* `:media` for rich media, media proxy
+* `:upload` - for proxying media when a remote uploader is used and `proxy_remote: true`.
-* `:upload` for uploaded media (if using a remote uploader and `proxy_remote: true`)
+* `:default` - for other requests.
-* `:default` for other requests
 
 For each pool, the options are:
 
-* `:size` - how much workers the pool can hold
+* `:size` - limit to how much requests can be concurrently executed.
 * `:timeout` - timeout while `gun` will wait for response
-* `:max_overflow` - additional workers if pool is under load
+* `:max_waiting` - limit to how much requests can be waiting for others to finish, after this is reached, subsequent requests will be dropped.
-
 
 ## Captcha
 
@@ -493,7 +492,7 @@ A built-in captcha provider. Enabled by default.
 #### Pleroma.Captcha.Kocaptcha
 
 Kocaptcha is a very simple captcha service with a single API endpoint,
-the source code is here: https://github.com/koto-bank/kocaptcha. The default endpoint
+the source code is here: [kocaptcha](https://github.com/koto-bank/kocaptcha). The default endpoint
 `https://captcha.kotobank.ch` is hosted by the developer.
 
 * `endpoint`: the Kocaptcha endpoint to use.
@@ -501,6 +500,7 @@ the source code is here: https://github.com/koto-bank/kocaptcha. The default end
 ## Uploads
 
 ### Pleroma.Upload
+
 * `uploader`: Which one of the [uploaders](#uploaders) to use.
 * `filters`: List of [upload filters](#upload-filters) to use.
 * `link_name`: When enabled Pleroma will add a `name` parameter to the url of the upload, for example `https://instance.tld/media/corndog.png?name=corndog.png`. This is needed to provide the correct filename in Content-Disposition headers when using filters like `Pleroma.Upload.Filter.Dedupe`
@@ -513,10 +513,15 @@ the source code is here: https://github.com/koto-bank/kocaptcha. The default end
     `strip_exif` has been replaced by `Pleroma.Upload.Filter.Mogrify`.
 
 ### Uploaders
+
 #### Pleroma.Uploaders.Local
+
 * `uploads`: Which directory to store the user-uploads in, relative to pleroma’s working directory.
 
 #### Pleroma.Uploaders.S3
+
+Don't forget to configure [Ex AWS S3](#ex-aws-s3-settings)
+
 * `bucket`: S3 bucket name.
 * `bucket_namespace`: S3 bucket namespace.
 * `public_endpoint`: S3 endpoint that the user finally accesses(ex. "https://s3.dualstack.ap-northeast-1.amazonaws.com")
@@ -525,17 +530,23 @@ For example, when using CDN to S3 virtual host format, set "".
 At this time, write CNAME to CDN in public_endpoint.
 * `streaming_enabled`: Enable streaming uploads, when enabled the file will be sent to the server in chunks as it's being read. This may be unsupported by some providers, try disabling this if you have upload problems.
 
+#### Ex AWS S3 settings
+
+* `access_key_id`: Access key ID
+* `secret_access_key`: Secret access key
+* `host`: S3 host
+
+Example:
+
+```elixir
+config :ex_aws, :s3,
+  access_key_id: "xxxxxxxxxx",
+  secret_access_key: "yyyyyyyyyy",
+  host: "s3.eu-central-1.amazonaws.com"
+```
 
 ### Upload filters
 
-#### Pleroma.Upload.Filter.Mogrify
-
-* `args`: List of actions for the `mogrify` command like `"strip"` or `["strip", "auto-orient", {"implode", "1"}]`.
-
-#### Pleroma.Upload.Filter.Dedupe
-
-No specific configuration.
-
 #### Pleroma.Upload.Filter.AnonymizeFilename
 
 This filter replaces the filename (not the path) of an upload. For complete obfuscation, add
@@ -543,6 +554,20 @@ This filter replaces the filename (not the path) of an upload. For complete obfu
 
 * `text`: Text to replace filenames in links. If empty, `{random}.extension` will be used. You can get the original filename extension by using `{extension}`, for example `custom-file-name.{extension}`.
 
+#### Pleroma.Upload.Filter.Dedupe
+
+No specific configuration.
+
+#### Pleroma.Upload.Filter.Exiftool
+
+This filter only strips the GPS and location metadata with Exiftool leaving color profiles and attributes intact.
+
+No specific configuration.
+
+#### Pleroma.Upload.Filter.Mogrify
+
+* `args`: List of actions for the `mogrify` command like `"strip"` or `["strip", "auto-orient", {"implode", "1"}]`.
+
 ## Email
 
 ### Pleroma.Emails.Mailer
@@ -603,8 +628,7 @@ Email notifications settings.
 Configuration options described in [Oban readme](https://github.com/sorentwo/oban#usage):
 
 * `repo` - app's Ecto repo (`Pleroma.Repo`)
-* `verbose` - logs verbosity
+* `log` - logs verbosity
-* `prune` - non-retryable jobs [pruning settings](https://github.com/sorentwo/oban#pruning) (`:disabled` / `{:maxlen, value}` / `{:maxage, value}`)
 * `queues` - job queues (see below)
 * `crontab` - periodic jobs, see [`Oban.Cron`](#obancron)
 
@@ -789,6 +813,8 @@ or
 curl -H "X-Admin-Token: somerandomtoken" "http://localhost:4000/api/pleroma/admin/users/invites"
 ```
 
+Warning: it's discouraged to use this feature because of the associated security risk: static / rarely changed instance-wide token is much weaker compared to email-password pair of a real admin user; consider using HTTP Basic Auth or OAuth-based authentication instead.
+
 ### :auth
 
 * `Pleroma.Web.Auth.PleromaAuthenticator`: default database authenticator.
@@ -969,11 +995,11 @@ config :pleroma, :database_config_whitelist, [
 
 ### :restrict_unauthenticated
 
-Restrict access for unauthenticated users to timelines (public and federate), user profiles and statuses.
+Restrict access for unauthenticated users to timelines (public and federated), user profiles and statuses.
 
 * `timelines`: public and federated timelines
   * `local`: public timeline
-  * `federated`
+  * `federated`: federated timeline (includes public timeline)
 * `profiles`: user profiles
   * `local`
   * `remote`
@@ -981,7 +1007,14 @@ Restrict access for unauthenticated users to timelines (public and federate), us
   * `local`
   * `remote`
 
+Note: setting `restrict_unauthenticated/timelines/local` to `true` has no practical sense if `restrict_unauthenticated/timelines/federated` is set to `false` (since local public activities will still be delivered to unauthenticated users as part of federated timeline).
 
 ## Pleroma.Web.ApiSpec.CastAndValidate
 
 * `:strict` a boolean, enables strict input validation (useful in development, not recommended in production). Defaults to `false`.
+
+## :instances_favicons
+
+Control favicons for instances.
+
+* `enabled`: Allow/disallow displaying and getting instances favicons

docs/configuration/howto_database_config.md

@@ -0,0 +1,151 @@
+# How to activate Pleroma in-database configuration
+## Explanation
+
+The configuration of Pleroma has traditionally been managed with a config file, e.g. `config/prod.secret.exs`. This method requires a restart of the application for any configuration changes to take effect. We have made it possible to control most settings in the AdminFE interface after running a migration script.
+
+## Migration to database config
+
+1. Stop your Pleroma instance and edit your Pleroma config to enable database configuration: 
+
+  ```
+  config :pleroma, configurable_from_database: true
+  ```
+
+2. Run the mix task to migrate to the database. You'll receive some debugging output and a few messages informing you of what happened.
+
+  **Source:**
+  
+  ```
+  $ mix pleroma.config migrate_to_db
+  ```
+  
+  or
+  
+  **OTP:**
+  
+  ```
+  $ ./bin/pleroma_ctl config migrate_to_db
+  ```
+
+  ```  
+  10:04:34.155 [debug] QUERY OK source="config" db=1.6ms decode=2.0ms queue=33.5ms idle=0.0ms
+SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 []
+Migrating settings from file: /home/pleroma/config/dev.secret.exs
+  
+  10:04:34.240 [debug] QUERY OK db=4.5ms queue=0.3ms idle=92.2ms
+TRUNCATE config; []
+  
+  10:04:34.244 [debug] QUERY OK db=2.8ms queue=0.3ms idle=97.2ms
+ALTER SEQUENCE config_id_seq RESTART; []
+  
+  10:04:34.256 [debug] QUERY OK source="config" db=0.8ms queue=1.4ms idle=109.8ms
+SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 WHERE ((c0."group" = $1) AND (c0."key" = $2)) [":pleroma", ":instance"]
+  
+  10:04:34.292 [debug] QUERY OK db=2.6ms queue=1.7ms idle=137.7ms
+INSERT INTO "config" ("group","key","value","inserted_at","updated_at") VALUES ($1,$2,$3,$4,$5) RETURNING "id" [":pleroma", ":instance", <<131, 108, 0, 0, 0, 1, 104, 2, 100, 0, 4, 110, 97, 109, 101, 109, 0, 0, 0, 7, 66, 108, 101, 114, 111, 109, 97, 106>>, ~N[2020-07-12 15:04:34], ~N[2020-07-12 15:04:34]]
+  Settings for key instance migrated.
+  Settings for group :pleroma migrated.
+  ```
+  
+3. It is recommended to backup your config file now.
+  ```
+  cp config/dev.secret.exs config/dev.secret.exs.orig
+  ```
+  
+4. Now you can edit your config file and strip it down to the only settings which are not possible to control in the database. e.g., the Postgres and webserver (Endpoint) settings cannot be controlled in the database because the application needs the settings to start up and access the database.
+
+ ⚠️ **THIS IS NOT REQUIRED**
+ 
+ Any settings in the database will override those in the config file, but you may find it less confusing if the setting is only declared in one place.
+
+ A non-exhaustive list of settings that are only possible in the config file include the following:
+
+* config :pleroma, Pleroma.Web.Endpoint
+* config :pleroma, Pleroma.Repo
+* config :pleroma, configurable_from_database
+* config :pleroma, :database, rum_enabled
+* config :pleroma, :connections_pool
+
+Here is an example of a server config stripped down after migration:
+
+```
+use Mix.Config
+
+config :pleroma, Pleroma.Web.Endpoint,
+  url: [host: "cool.pleroma.site", scheme: "https", port: 443]
+
+
+config :pleroma, Pleroma.Repo,
+  adapter: Ecto.Adapters.Postgres,
+  username: "pleroma",
+  password: "MySecretPassword",
+  database: "pleroma_prod",
+  hostname: "localhost"
+
+config :pleroma, configurable_from_database: true
+```
+
+5. Start your instance back up and you can now access the Settings tab in AdminFE.
+
+
+## Reverting back from database config
+
+1. Stop your Pleroma instance.
+
+2. Run the mix task to migrate back from the database. You'll receive some debugging output and a few messages informing you of what happened.
+
+  **Source:**
+  
+  ```
+  $ mix pleroma.config migrate_from_db
+  ```
+  
+  or
+  
+  **OTP:**
+  
+  ```
+  $ ./bin/pleroma_ctl config migrate_from_db
+  ```
+
+  ```
+  10:26:30.593 [debug] QUERY OK source="config" db=9.8ms decode=1.2ms queue=26.0ms idle=0.0ms
+SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 []
+
+  10:26:30.659 [debug] QUERY OK source="config" db=1.1ms idle=80.7ms
+SELECT c0."id", c0."key", c0."group", c0."value", c0."inserted_at", c0."updated_at" FROM "config" AS c0 []
+Database configuration settings have been saved to config/dev.exported_from_db.secret.exs
+```
+
+3. The in-database configuration still exists, but it will not be used if you remove `config :pleroma, configurable_from_database: true` from your config.
+
+## Debugging
+
+### Clearing database config
+You can clear the database config by truncating the `config` table in the database. e.g.,
+
+```
+psql -d pleroma_dev
+pleroma_dev=# TRUNCATE config;
+TRUNCATE TABLE
+```
+
+Additionally, every time you migrate the configuration to the database the config table is automatically truncated to ensure a clean migration.
+
+### Manually removing a setting
+If you encounter a situation where the server cannot run properly because of an invalid setting in the database and this is preventing you from accessing AdminFE, you can manually remove the offending setting if you know which one it is.
+
+e.g., here is an example showing a minimal configuration in the database. Only the `config :pleroma, :instance` settings are in the table:
+
+```
+psql -d pleroma_dev
+pleroma_dev=# select * from config;
+ id |    key    |                           value                            |     inserted_at     |     updated_at      |  group
+----+-----------+------------------------------------------------------------+---------------------+---------------------+----------
+  1 | :instance | \x836c0000000168026400046e616d656d00000007426c65726f6d616a | 2020-07-12 15:33:29 | 2020-07-12 15:33:29 | :pleroma
+(1 row)
+pleroma_dev=# delete from config where key = ':instance' and group = ':pleroma';
+DELETE 1
+```
+
+Now the `config :pleroma, :instance` settings have been removed from the database.

lib/mix/pleroma.ex

@@ -3,15 +3,48 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Mix.Pleroma do
+  @apps [
+    :restarter,
+    :ecto,
+    :ecto_sql,
+    :postgrex,
+    :db_connection,
+    :cachex,
+    :flake_id,
+    :swoosh,
+    :timex
+  ]
+  @cachex_children ["object", "user"]
   @doc "Common functions to be reused in mix tasks"
   def start_pleroma do
+    Pleroma.Config.Holder.save_default()
     Application.put_env(:phoenix, :serve_endpoints, false, persistent: true)
 
     if Pleroma.Config.get(:env) != :test do
       Application.put_env(:logger, :console, level: :debug)
     end
 
-    {:ok, _} = Application.ensure_all_started(:pleroma)
+    apps =
+      if Application.get_env(:tesla, :adapter) == Tesla.Adapter.Gun do
+        [:gun | @apps]
+      else
+        [:hackney | @apps]
+      end
+
+    Enum.each(apps, &Application.ensure_all_started/1)
+
+    children = [
+      Pleroma.Repo,
+      {Pleroma.Config.TransferTask, false},
+      Pleroma.Web.Endpoint
+    ]
+
+    cachex_children = Enum.map(@cachex_children, &Pleroma.Application.build_cachex(&1, []))
+
+    Supervisor.start_link(children ++ cachex_children,
+      strategy: :one_for_one,
+      name: Pleroma.Supervisor
+    )
 
     if Pleroma.Config.get(:env) not in [:test, :benchmark] do
       pleroma_rebooted?()

lib/mix/tasks/pleroma/config.ex

@@ -83,7 +83,7 @@ defmodule Mix.Tasks.Pleroma.Config do
 
   defp migrate_from_db(opts) do
     if Pleroma.Config.get([:configurable_from_database]) do
-      env = opts[:env] || "prod"
+      env = opts[:env] || Pleroma.Config.get(:env)
 
       config_path =
         if Pleroma.Config.get(:release) do
@@ -105,6 +105,10 @@ defmodule Mix.Tasks.Pleroma.Config do
 
       :ok = File.close(file)
       System.cmd("mix", ["format", config_path])
+
+      shell_info(
+        "Database configuration settings have been exported to config/#{env}.exported_from_db.secret.exs"
+      )
     else
       migration_error()
     end
@@ -112,7 +116,7 @@ defmodule Mix.Tasks.Pleroma.Config do
 
   defp migration_error do
     shell_error(
-      "Migration is not allowed in config. You can change this behavior by setting `configurable_from_database` to true."
+      "Migration is not allowed in config. You can change this behavior by setting `config :pleroma, configurable_from_database: true`"
     )
   end
 

lib/mix/tasks/pleroma/instance.ex

@@ -145,7 +145,7 @@ defmodule Mix.Tasks.Pleroma.Instance do
           options,
           :uploads_dir,
           "What directory should media uploads go in (when using the local uploader)?",
-          Pleroma.Config.get([Pleroma.Uploaders.Local, :uploads])
+          Config.get([Pleroma.Uploaders.Local, :uploads])
         )
         |> Path.expand()
 
@@ -154,7 +154,7 @@ defmodule Mix.Tasks.Pleroma.Instance do
           options,
           :static_dir,
           "What directory should custom public files be read from (custom emojis, frontend bundle overrides, robots.txt, etc.)?",
-          Pleroma.Config.get([:instance, :static_dir])
+          Config.get([:instance, :static_dir])
         )
         |> Path.expand()
 

lib/mix/tasks/pleroma/notification_settings.ex

@@ -3,8 +3,8 @@ defmodule Mix.Tasks.Pleroma.NotificationSettings do
   @moduledoc """
   Example:
 
-  > mix pleroma.notification_settings --privacy-option=false --nickname-users="parallel588"  # set false only for parallel588 user
+  > mix pleroma.notification_settings --hide-notification-contents=false --nickname-users="parallel588"  # set false only for parallel588 user
-  > mix pleroma.notification_settings --privacy-option=true # set true for all users
+  > mix pleroma.notification_settings --hide-notification-contents=true # set true for all users
 
   """
 
@@ -19,16 +19,16 @@ defmodule Mix.Tasks.Pleroma.NotificationSettings do
       OptionParser.parse(
         args,
         strict: [
-          privacy_option: :boolean,
+          hide_notification_contents: :boolean,
           email_users: :string,
           nickname_users: :string
         ]
       )
 
-    privacy_option = Keyword.get(options, :privacy_option)
+    hide_notification_contents = Keyword.get(options, :hide_notification_contents)
 
-    if not is_nil(privacy_option) do
+    if not is_nil(hide_notification_contents) do
-      privacy_option
+      hide_notification_contents
       |> build_query(options)
       |> Pleroma.Repo.update_all([])
     end
@@ -36,15 +36,15 @@ defmodule Mix.Tasks.Pleroma.NotificationSettings do
     shell_info("Done")
   end
 
-  defp build_query(privacy_option, options) do
+  defp build_query(hide_notification_contents, options) do
     query =
       from(u in Pleroma.User,
         update: [
           set: [
             notification_settings:
               fragment(
-                "jsonb_set(notification_settings, '{privacy_option}', ?)",
+                "jsonb_set(notification_settings, '{hide_notification_contents}', ?)",
-                ^privacy_option
+                ^hide_notification_contents
               )
           ]
         ]

lib/mix/tasks/pleroma/user.ex

@@ -232,7 +232,7 @@ defmodule Mix.Tasks.Pleroma.User do
     with %User{} = user <- User.get_cached_by_nickname(nickname) do
       user = user |> User.tag(tags)
 
-      shell_info("Tags of #{user.nickname}: #{inspect(tags)}")
+      shell_info("Tags of #{user.nickname}: #{inspect(user.tags)}")
     else
       _ ->
         shell_error("Could not change user tags for #{nickname}")
@@ -245,7 +245,7 @@ defmodule Mix.Tasks.Pleroma.User do
     with %User{} = user <- User.get_cached_by_nickname(nickname) do
       user = user |> User.untag(tags)
 
-      shell_info("Tags of #{user.nickname}: #{inspect(tags)}")
+      shell_info("Tags of #{user.nickname}: #{inspect(user.tags)}")
     else
       _ ->
         shell_error("Could not change user tags for #{nickname}")

lib/pleroma/application.ex

@@ -35,13 +35,19 @@ defmodule Pleroma.Application do
   # See http://elixir-lang.org/docs/stable/elixir/Application.html
   # for more information on OTP Applications
   def start(_type, _args) do
-    Pleroma.Config.Holder.save_default()
+    # Scrubbers are compiled at runtime and therefore will cause a conflict
+    # every time the application is restarted, so we disable module
+    # conflicts at runtime
+    Code.compiler_options(ignore_module_conflict: true)
+    Pleroma.Telemetry.Logger.attach()
+    Config.Holder.save_default()
     Pleroma.HTML.compile_scrubbers()
     Config.DeprecationWarnings.warn()
     Pleroma.Plugs.HTTPSecurityPlug.warn_if_disabled()
     Pleroma.ApplicationRequirements.verify!()
     setup_instrumenters()
     load_custom_modules()
+    Pleroma.Docs.JSON.compile()
 
     adapter = Application.get_env(:tesla, :adapter)
 
@@ -162,7 +168,8 @@ defmodule Pleroma.Application do
   defp seconds_valid_interval,
     do: :timer.seconds(Config.get!([Pleroma.Captcha, :seconds_valid]))
 
-  defp build_cachex(type, opts),
+  @spec build_cachex(String.t(), keyword()) :: map()
+  def build_cachex(type, opts),
     do: %{
       id: String.to_atom("cachex_" <> type),
       start: {Cachex, :start_link, [String.to_atom(type <> "_cache"), opts]},
@@ -217,9 +224,7 @@ defmodule Pleroma.Application do
 
   # start hackney and gun pools in tests
   defp http_children(_, :test) do
-    hackney_options = Config.get([:hackney_pools, :federation])
+    http_children(Tesla.Adapter.Hackney, nil) ++ http_children(Tesla.Adapter.Gun, nil)
-    hackney_pool = :hackney_pool.child_spec(:federation, hackney_options)
-    [hackney_pool, Pleroma.Pool.Supervisor]
   end
 
   defp http_children(Tesla.Adapter.Hackney, _) do
@@ -238,7 +243,10 @@ defmodule Pleroma.Application do
     end
   end
 
-  defp http_children(Tesla.Adapter.Gun, _), do: [Pleroma.Pool.Supervisor]
+  defp http_children(Tesla.Adapter.Gun, _) do
+    Pleroma.Gun.ConnectionPool.children() ++
+      [{Task, &Pleroma.HTTP.AdapterHelper.Gun.limiter_setup/0}]
+  end
 
   defp http_children(_, _), do: []
 end

lib/pleroma/config/deprecation_warnings.ex

@@ -54,6 +54,7 @@ defmodule Pleroma.Config.DeprecationWarnings do
     check_hellthread_threshold()
     mrf_user_allowlist()
     check_old_mrf_config()
+    check_media_proxy_whitelist_config()
   end
 
   def check_old_mrf_config do
@@ -65,7 +66,7 @@ defmodule Pleroma.Config.DeprecationWarnings do
     move_namespace_and_warn(@mrf_config_map, warning_preface)
   end
 
-  @spec move_namespace_and_warn([config_map()], String.t()) :: :ok
+  @spec move_namespace_and_warn([config_map()], String.t()) :: :ok | nil
   def move_namespace_and_warn(config_map, warning_preface) do
     warning =
       Enum.reduce(config_map, "", fn
@@ -84,4 +85,16 @@ defmodule Pleroma.Config.DeprecationWarnings do
       Logger.warn(warning_preface <> warning)
     end
   end
+
+  @spec check_media_proxy_whitelist_config() :: :ok | nil
+  def check_media_proxy_whitelist_config do
+    whitelist = Config.get([:media_proxy, :whitelist])
+
+    if Enum.any?(whitelist, &(not String.starts_with?(&1, "http"))) do
+      Logger.warn("""
+      !!!DEPRECATION WARNING!!!
+      Your config is using old format (only domain) for MediaProxy whitelist option. Setting should work for now, but you are advised to change format to scheme with port to prevent possible issues later.
+      """)
+    end
+  end
 end

lib/pleroma/config/loader.ex

@@ -12,6 +12,11 @@ defmodule Pleroma.Config.Loader do
     :swarm
   ]
 
+  @reject_groups [
+    :postgrex,
+    :tesla
+  ]
+
   if Code.ensure_loaded?(Config.Reader) do
     @reader Config.Reader
 
@@ -47,7 +52,8 @@ defmodule Pleroma.Config.Loader do
   @spec filter_group(atom(), keyword()) :: keyword()
   def filter_group(group, configs) do
     Enum.reject(configs[group], fn {key, _v} ->
-      key in @reject_keys or (group == :phoenix and key == :serve_endpoints) or group == :postgrex
+      key in @reject_keys or group in @reject_groups or
+        (group == :phoenix and key == :serve_endpoints)
     end)
   end
 end

lib/pleroma/config/transfer_task.ex

@@ -31,8 +31,8 @@ defmodule Pleroma.Config.TransferTask do
     {:pleroma, :gopher, [:enabled]}
   ]
 
-  def start_link(_) do
+  def start_link(restart_pleroma? \\ true) do
-    load_and_update_env()
+    load_and_update_env([], restart_pleroma?)
     if Config.get(:env) == :test, do: Ecto.Adapters.SQL.Sandbox.checkin(Repo)
     :ignore
   end

lib/pleroma/docs/generator.ex

@@ -6,16 +6,21 @@ defmodule Pleroma.Docs.Generator do
     implementation.process(descriptions)
   end
 
-  @spec list_modules_in_dir(String.t(), String.t()) :: [module()]
+  @spec list_behaviour_implementations(behaviour :: module()) :: [module()]
-  def list_modules_in_dir(dir, start) do
+  def list_behaviour_implementations(behaviour) do
-    with {:ok, files} <- File.ls(dir) do
+    :code.all_loaded()
-      files
+    |> Enum.filter(fn {module, _} ->
-      |> Enum.filter(&String.ends_with?(&1, ".ex"))
+      # This shouldn't be needed as all modules are expected to have module_info/1,
-      |> Enum.map(fn filename ->
+      # but in test enviroments some transient modules `:elixir_compiler_XX`
-        module = filename |> String.trim_trailing(".ex") |> Macro.camelize()
+      # are loaded for some reason (where XX is a random integer).
-        String.to_atom(start <> module)
+      if function_exported?(module, :module_info, 1) do
-      end)
+        module.module_info(:attributes)
+        |> Keyword.get_values(:behaviour)
+        |> List.flatten()
+        |> Enum.member?(behaviour)
       end
+    end)
+    |> Enum.map(fn {module, _} -> module end)
   end
 
   @doc """
@@ -87,6 +92,12 @@ defmodule Pleroma.Docs.Generator do
       else: string
   end
 
+  defp format_suggestions({:list_behaviour_implementations, behaviour}) do
+    behaviour
+    |> list_behaviour_implementations()
+    |> format_suggestions()
+  end
+
   defp format_suggestions([]), do: []
 
   defp format_suggestions([suggestion | tail]) do

lib/pleroma/docs/json.ex

@@ -1,5 +1,19 @@
 defmodule Pleroma.Docs.JSON do
   @behaviour Pleroma.Docs.Generator
+  @external_resource "config/description.exs"
+  @raw_config Pleroma.Config.Loader.read("config/description.exs")
+  @raw_descriptions @raw_config[:pleroma][:config_description]
+  @term __MODULE__.Compiled
+
+  @spec compile :: :ok
+  def compile do
+    :persistent_term.put(@term, Pleroma.Docs.Generator.convert_to_strings(@raw_descriptions))
+  end
+
+  @spec compiled_descriptions :: Map.t()
+  def compiled_descriptions do
+    :persistent_term.get(@term)
+  end
 
   @spec process(keyword()) :: {:ok, String.t()}
   def process(descriptions) do
@@ -13,11 +27,4 @@ defmodule Pleroma.Docs.JSON do
       {:ok, path}
     end
   end
-
-  def compile do
-    with config <- Pleroma.Config.Loader.read("config/description.exs") do
-      config[:pleroma][:config_description]
-      |> Pleroma.Docs.Generator.convert_to_strings()
-    end
-  end
 end

lib/pleroma/docs/markdown.ex

@@ -68,6 +68,11 @@ defmodule Pleroma.Docs.Markdown do
     IO.write(file, "  #{list_mark}`#{inspect(suggestion)}`\n")
   end
 
+  defp print_suggestions(file, {:list_behaviour_implementations, behaviour}) do
+    suggestions = Pleroma.Docs.Generator.list_behaviour_implementations(behaviour)
+    print_suggestions(file, suggestions)
+  end
+
   defp print_suggestions(_file, nil), do: nil
 
   defp print_suggestions(_file, ""), do: nil

lib/pleroma/emails/admin_email.ex

@@ -10,7 +10,7 @@ defmodule Pleroma.Emails.AdminEmail do
   alias Pleroma.Config
   alias Pleroma.Web.Router.Helpers
 
-  defp instance_config, do: Pleroma.Config.get(:instance)
+  defp instance_config, do: Config.get(:instance)
   defp instance_name, do: instance_config()[:name]
 
   defp instance_notify_email do
@@ -72,6 +72,8 @@ defmodule Pleroma.Emails.AdminEmail do
     <p>Reported Account: <a href="#{user_url(account)}">#{account.nickname}</a></p>
     #{comment_html}
     #{statuses_html}
+    <p>
+    <a href="#{Pleroma.Web.base_url()}/pleroma/admin/#/reports/index">View Reports in AdminFE</a>
     """
 
     new()

lib/pleroma/emoji/loader.ex

@@ -108,7 +108,7 @@ defmodule Pleroma.Emoji.Loader do
       if File.exists?(emoji_txt) do
         load_from_file(emoji_txt, emoji_groups)
       else
-        extensions = Pleroma.Config.get([:emoji, :pack_extensions])
+        extensions = Config.get([:emoji, :pack_extensions])
 
         Logger.info(
           "No emoji.txt found for pack \"#{pack_name}\", assuming all #{

lib/pleroma/filter.ex

@@ -34,10 +34,18 @@ defmodule Pleroma.Filter do
     Repo.one(query)
   end
 
-  def get_filters(%User{id: user_id} = _user) do
+  def get_active(query) do
+    from(f in query, where: is_nil(f.expires_at) or f.expires_at > ^NaiveDateTime.utc_now())
+  end
+
+  def get_irreversible(query) do
+    from(f in query, where: f.hide)
+  end
+
+  def get_filters(query \\ __MODULE__, %User{id: user_id}) do
     query =
       from(
-        f in Pleroma.Filter,
+        f in query,
         where: f.user_id == ^user_id,
         order_by: [desc: :id]
       )
@@ -95,4 +103,34 @@ defmodule Pleroma.Filter do
     |> validate_required([:phrase, :context])
     |> Repo.update()
   end
+
+  def compose_regex(user_or_filters, format \\ :postgres)
+
+  def compose_regex(%User{} = user, format) do
+    __MODULE__
+    |> get_active()
+    |> get_irreversible()
+    |> get_filters(user)
+    |> compose_regex(format)
+  end
+
+  def compose_regex([_ | _] = filters, format) do
+    phrases =
+      filters
+      |> Enum.map(& &1.phrase)
+      |> Enum.join("|")
+
+    case format do
+      :postgres ->
+        "\\y(#{phrases})\\y"
+
+      :re ->
+        ~r/\b#{phrases}\b/i
+
+      _ ->
+        nil
+    end
+  end
+
+  def compose_regex(_, _), do: nil
 end

lib/pleroma/gun/api.ex

@@ -19,7 +19,8 @@ defmodule Pleroma.Gun.API do
     :tls_opts,
     :tcp_opts,
     :socks_opts,
-    :ws_opts
+    :ws_opts,
+    :supervise
   ]
 
   @impl Gun

lib/pleroma/gun/conn.ex

@@ -3,85 +3,33 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Pleroma.Gun.Conn do
-  @moduledoc """
-  Struct for gun connection data
-  """
   alias Pleroma.Gun
-  alias Pleroma.Pool.Connections
 
   require Logger
 
-  @type gun_state :: :up | :down
+  def open(%URI{} = uri, opts) do
-  @type conn_state :: :active | :idle
-
-  @type t :: %__MODULE__{
-          conn: pid(),
-          gun_state: gun_state(),
-          conn_state: conn_state(),
-          used_by: [pid()],
-          last_reference: pos_integer(),
-          crf: float(),
-          retries: pos_integer()
-        }
-
-  defstruct conn: nil,
-            gun_state: :open,
-            conn_state: :init,
-            used_by: [],
-            last_reference: 0,
-            crf: 1,
-            retries: 0
-
-  @spec open(String.t() | URI.t(), atom(), keyword()) :: :ok | nil
-  def open(url, name, opts \\ [])
-  def open(url, name, opts) when is_binary(url), do: open(URI.parse(url), name, opts)
-
-  def open(%URI{} = uri, name, opts) do
     pool_opts = Pleroma.Config.get([:connections_pool], [])
 
     opts =
       opts
       |> Enum.into(%{})
-      |> Map.put_new(:retry, pool_opts[:retry] || 1)
-      |> Map.put_new(:retry_timeout, pool_opts[:retry_timeout] || 1000)
       |> Map.put_new(:await_up_timeout, pool_opts[:await_up_timeout] || 5_000)
+      |> Map.put_new(:supervise, false)
       |> maybe_add_tls_opts(uri)
 
-    key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
-
-    max_connections = pool_opts[:max_connections] || 250
-
-    conn_pid =
-      if Connections.count(name) < max_connections do
     do_open(uri, opts)
-      else
-        close_least_used_and_do_open(name, uri, opts)
-      end
-
-    if is_pid(conn_pid) do
-      conn = %Pleroma.Gun.Conn{
-        conn: conn_pid,
-        gun_state: :up,
-        conn_state: :active,
-        last_reference: :os.system_time(:second)
-      }
-
-      :ok = Gun.set_owner(conn_pid, Process.whereis(name))
-      Connections.add_conn(name, key, conn)
-    end
   end
 
   defp maybe_add_tls_opts(opts, %URI{scheme: "http"}), do: opts
 
-  defp maybe_add_tls_opts(opts, %URI{scheme: "https", host: host}) do
+  defp maybe_add_tls_opts(opts, %URI{scheme: "https"}) do
     tls_opts = [
       verify: :verify_peer,
       cacertfile: CAStore.file_path(),
       depth: 20,
       reuse_sessions: false,
-      verify_fun:
+      log_level: :warning,
-        {&:ssl_verify_hostname.verify_fun/3,
+      customize_hostname_check: [match_fun: :public_key.pkix_verify_hostname_match_fun(:https)]
-         [check_hostname: Pleroma.HTTP.Connection.format_host(host)]}
     ]
 
     tls_opts =
@@ -105,7 +53,7 @@ defmodule Pleroma.Gun.Conn do
          {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]),
          stream <- Gun.connect(conn, connect_opts),
          {:response, :fin, 200, _} <- Gun.await(conn, stream) do
-      conn
+      {:ok, conn}
     else
       error ->
         Logger.warn(
@@ -141,7 +89,7 @@ defmodule Pleroma.Gun.Conn do
 
     with {:ok, conn} <- Gun.open(proxy_host, proxy_port, opts),
          {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do
-      conn
+      {:ok, conn}
     else
       error ->
         Logger.warn(
@@ -155,11 +103,11 @@ defmodule Pleroma.Gun.Conn do
   end
 
   defp do_open(%URI{host: host, port: port} = uri, opts) do
-    host = Pleroma.HTTP.Connection.parse_host(host)
+    host = Pleroma.HTTP.AdapterHelper.parse_host(host)
 
     with {:ok, conn} <- Gun.open(host, port, opts),
          {:ok, _} <- Gun.await_up(conn, opts[:await_up_timeout]) do
-      conn
+      {:ok, conn}
     else
       error ->
         Logger.warn(
@@ -171,7 +119,7 @@ defmodule Pleroma.Gun.Conn do
   end
 
   defp destination_opts(%URI{host: host, port: port}) do
-    host = Pleroma.HTTP.Connection.parse_host(host)
+    host = Pleroma.HTTP.AdapterHelper.parse_host(host)
     %{host: host, port: port}
   end
 
@@ -181,17 +129,6 @@ defmodule Pleroma.Gun.Conn do
 
   defp add_http2_opts(opts, _, _), do: opts
 
-  defp close_least_used_and_do_open(name, uri, opts) do
-    with [{key, conn} | _conns] <- Connections.get_unused_conns(name),
-         :ok <- Gun.close(conn.conn) do
-      Connections.remove_conn(name, key)
-
-      do_open(uri, opts)
-    else
-      [] -> {:error, :pool_overflowed}
-    end
-  end
-
   def compose_uri_log(%URI{scheme: scheme, host: host, path: path}) do
     "#{scheme}://#{host}#{path}"
   end

lib/pleroma/gun/connection_pool.ex

@@ -0,0 +1,79 @@
+defmodule Pleroma.Gun.ConnectionPool do
+  @registry __MODULE__
+
+  alias Pleroma.Gun.ConnectionPool.WorkerSupervisor
+
+  def children do
+    [
+      {Registry, keys: :unique, name: @registry},
+      Pleroma.Gun.ConnectionPool.WorkerSupervisor
+    ]
+  end
+
+  def get_conn(uri, opts) do
+    key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
+
+    case Registry.lookup(@registry, key) do
+      # The key has already been registered, but connection is not up yet
+      [{worker_pid, nil}] ->
+        get_gun_pid_from_worker(worker_pid, true)
+
+      [{worker_pid, {gun_pid, _used_by, _crf, _last_reference}}] ->
+        GenServer.cast(worker_pid, {:add_client, self(), false})
+        {:ok, gun_pid}
+
+      [] ->
+        # :gun.set_owner fails in :connected state for whatevever reason,
+        # so we open the connection in the process directly and send it's pid back
+        # We trust gun to handle timeouts by itself
+        case WorkerSupervisor.start_worker([key, uri, opts, self()]) do
+          {:ok, worker_pid} ->
+            get_gun_pid_from_worker(worker_pid, false)
+
+          {:error, {:already_started, worker_pid}} ->
+            get_gun_pid_from_worker(worker_pid, true)
+
+          err ->
+            err
+        end
+    end
+  end
+
+  defp get_gun_pid_from_worker(worker_pid, register) do
+    # GenServer.call will block the process for timeout length if
+    # the server crashes on startup (which will happen if gun fails to connect)
+    # so instead we use cast + monitor
+
+    ref = Process.monitor(worker_pid)
+    if register, do: GenServer.cast(worker_pid, {:add_client, self(), true})
+
+    receive do
+      {:conn_pid, pid} ->
+        Process.demonitor(ref)
+        {:ok, pid}
+
+      {:DOWN, ^ref, :process, ^worker_pid, reason} ->
+        case reason do
+          {:shutdown, error} -> error
+          _ -> {:error, reason}
+        end
+    end
+  end
+
+  def release_conn(conn_pid) do
+    # :ets.fun2ms(fn {_, {worker_pid, {gun_pid, _, _, _}}} when gun_pid == conn_pid ->
+    #    worker_pid end)
+    query_result =
+      Registry.select(@registry, [
+        {{:_, :"$1", {:"$2", :_, :_, :_}}, [{:==, :"$2", conn_pid}], [:"$1"]}
+      ])
+
+    case query_result do
+      [worker_pid] ->
+        GenServer.cast(worker_pid, {:remove_client, self()})
+
+      [] ->
+        :ok
+    end
+  end
+end

lib/pleroma/gun/connection_pool/reclaimer.ex

@@ -0,0 +1,85 @@
+defmodule Pleroma.Gun.ConnectionPool.Reclaimer do
+  use GenServer, restart: :temporary
+
+  @registry Pleroma.Gun.ConnectionPool
+
+  def start_monitor do
+    pid =
+      case :gen_server.start(__MODULE__, [], name: {:via, Registry, {@registry, "reclaimer"}}) do
+        {:ok, pid} ->
+          pid
+
+        {:error, {:already_registered, pid}} ->
+          pid
+      end
+
+    {pid, Process.monitor(pid)}
+  end
+
+  @impl true
+  def init(_) do
+    {:ok, nil, {:continue, :reclaim}}
+  end
+
+  @impl true
+  def handle_continue(:reclaim, _) do
+    max_connections = Pleroma.Config.get([:connections_pool, :max_connections])
+
+    reclaim_max =
+      [:connections_pool, :reclaim_multiplier]
+      |> Pleroma.Config.get()
+      |> Kernel.*(max_connections)
+      |> round
+      |> max(1)
+
+    :telemetry.execute([:pleroma, :connection_pool, :reclaim, :start], %{}, %{
+      max_connections: max_connections,
+      reclaim_max: reclaim_max
+    })
+
+    # :ets.fun2ms(
+    # fn {_, {worker_pid, {_, used_by, crf, last_reference}}} when used_by == [] ->
+    #   {worker_pid, crf, last_reference} end)
+    unused_conns =
+      Registry.select(
+        @registry,
+        [
+          {{:_, :"$1", {:_, :"$2", :"$3", :"$4"}}, [{:==, :"$2", []}], [{{:"$1", :"$3", :"$4"}}]}
+        ]
+      )
+
+    case unused_conns do
+      [] ->
+        :telemetry.execute(
+          [:pleroma, :connection_pool, :reclaim, :stop],
+          %{reclaimed_count: 0},
+          %{
+            max_connections: max_connections
+          }
+        )
+
+        {:stop, :no_unused_conns, nil}
+
+      unused_conns ->
+        reclaimed =
+          unused_conns
+          |> Enum.sort(fn {_pid1, crf1, last_reference1}, {_pid2, crf2, last_reference2} ->
+            crf1 <= crf2 and last_reference1 <= last_reference2
+          end)
+          |> Enum.take(reclaim_max)
+
+        reclaimed
+        |> Enum.each(fn {pid, _, _} ->
+          DynamicSupervisor.terminate_child(Pleroma.Gun.ConnectionPool.WorkerSupervisor, pid)
+        end)
+
+        :telemetry.execute(
+          [:pleroma, :connection_pool, :reclaim, :stop],
+          %{reclaimed_count: Enum.count(reclaimed)},
+          %{max_connections: max_connections}
+        )
+
+        {:stop, :normal, nil}
+    end
+  end
+end

lib/pleroma/gun/connection_pool/worker.ex

@@ -0,0 +1,127 @@
+defmodule Pleroma.Gun.ConnectionPool.Worker do
+  alias Pleroma.Gun
+  use GenServer, restart: :temporary
+
+  @registry Pleroma.Gun.ConnectionPool
+
+  def start_link([key | _] = opts) do
+    GenServer.start_link(__MODULE__, opts, name: {:via, Registry, {@registry, key}})
+  end
+
+  @impl true
+  def init([_key, _uri, _opts, _client_pid] = opts) do
+    {:ok, nil, {:continue, {:connect, opts}}}
+  end
+
+  @impl true
+  def handle_continue({:connect, [key, uri, opts, client_pid]}, _) do
+    with {:ok, conn_pid} <- Gun.Conn.open(uri, opts),
+         Process.link(conn_pid) do
+      time = :erlang.monotonic_time(:millisecond)
+
+      {_, _} =
+        Registry.update_value(@registry, key, fn _ ->
+          {conn_pid, [client_pid], 1, time}
+        end)
+
+      send(client_pid, {:conn_pid, conn_pid})
+
+      {:noreply,
+       %{key: key, timer: nil, client_monitors: %{client_pid => Process.monitor(client_pid)}},
+       :hibernate}
+    else
+      err ->
+        {:stop, {:shutdown, err}, nil}
+    end
+  end
+
+  @impl true
+  def handle_cast({:add_client, client_pid, send_pid_back}, %{key: key} = state) do
+    time = :erlang.monotonic_time(:millisecond)
+
+    {{conn_pid, _, _, _}, _} =
+      Registry.update_value(@registry, key, fn {conn_pid, used_by, crf, last_reference} ->
+        {conn_pid, [client_pid | used_by], crf(time - last_reference, crf), time}
+      end)
+
+    if send_pid_back, do: send(client_pid, {:conn_pid, conn_pid})
+
+    state =
+      if state.timer != nil do
+        Process.cancel_timer(state[:timer])
+        %{state | timer: nil}
+      else
+        state
+      end
+
+    ref = Process.monitor(client_pid)
+
+    state = put_in(state.client_monitors[client_pid], ref)
+    {:noreply, state, :hibernate}
+  end
+
+  @impl true
+  def handle_cast({:remove_client, client_pid}, %{key: key} = state) do
+    {{_conn_pid, used_by, _crf, _last_reference}, _} =
+      Registry.update_value(@registry, key, fn {conn_pid, used_by, crf, last_reference} ->
+        {conn_pid, List.delete(used_by, client_pid), crf, last_reference}
+      end)
+
+    {ref, state} = pop_in(state.client_monitors[client_pid])
+    Process.demonitor(ref)
+
+    timer =
+      if used_by == [] do
+        max_idle = Pleroma.Config.get([:connections_pool, :max_idle_time], 30_000)
+        Process.send_after(self(), :idle_close, max_idle)
+      else
+        nil
+      end
+
+    {:noreply, %{state | timer: timer}, :hibernate}
+  end
+
+  @impl true
+  def handle_info(:idle_close, state) do
+    # Gun monitors the owner process, and will close the connection automatically
+    # when it's terminated
+    {:stop, :normal, state}
+  end
+
+  # Gracefully shutdown if the connection got closed without any streams left
+  @impl true
+  def handle_info({:gun_down, _pid, _protocol, _reason, []}, state) do
+    {:stop, :normal, state}
+  end
+
+  # Otherwise, shutdown with an error
+  @impl true
+  def handle_info({:gun_down, _pid, _protocol, _reason, _killed_streams} = down_message, state) do
+    {:stop, {:error, down_message}, state}
+  end
+
+  @impl true
+  def handle_info({:DOWN, _ref, :process, pid, reason}, state) do
+    # Sometimes the client is dead before we demonitor it in :remove_client, so the message
+    # arrives anyway
+
+    case state.client_monitors[pid] do
+      nil ->
+        {:noreply, state, :hibernate}
+
+      _ref ->
+        :telemetry.execute(
+          [:pleroma, :connection_pool, :client_death],
+          %{client_pid: pid, reason: reason},
+          %{key: state.key}
+        )
+
+        handle_cast({:remove_client, pid}, state)
+    end
+  end
+
+  # LRFU policy: https://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.55.1478
+  defp crf(time_delta, prev_crf) do
+    1 + :math.pow(0.5, 0.0001 * time_delta) * prev_crf
+  end
+end

lib/pleroma/gun/connection_pool/worker_supervisor.ex

@@ -0,0 +1,45 @@
+defmodule Pleroma.Gun.ConnectionPool.WorkerSupervisor do
+  @moduledoc "Supervisor for pool workers. Does not do anything except enforce max connection limit"
+
+  use DynamicSupervisor
+
+  def start_link(opts) do
+    DynamicSupervisor.start_link(__MODULE__, opts, name: __MODULE__)
+  end
+
+  def init(_opts) do
+    DynamicSupervisor.init(
+      strategy: :one_for_one,
+      max_children: Pleroma.Config.get([:connections_pool, :max_connections])
+    )
+  end
+
+  def start_worker(opts, retry \\ false) do
+    case DynamicSupervisor.start_child(__MODULE__, {Pleroma.Gun.ConnectionPool.Worker, opts}) do
+      {:error, :max_children} ->
+        if retry or free_pool() == :error do
+          :telemetry.execute([:pleroma, :connection_pool, :provision_failure], %{opts: opts})
+          {:error, :pool_full}
+        else
+          start_worker(opts, true)
+        end
+
+      res ->
+        res
+    end
+  end
+
+  defp free_pool do
+    wait_for_reclaimer_finish(Pleroma.Gun.ConnectionPool.Reclaimer.start_monitor())
+  end
+
+  defp wait_for_reclaimer_finish({pid, mon}) do
+    receive do
+      {:DOWN, ^mon, :process, ^pid, :no_unused_conns} ->
+        :error
+
+      {:DOWN, ^mon, :process, ^pid, :normal} ->
+        :ok
+    end
+  end
+end

lib/pleroma/html.ex

@@ -109,7 +109,7 @@ defmodule Pleroma.HTML do
       result =
         content
         |> Floki.parse_fragment!()
-        |> Floki.filter_out("a.mention,a.hashtag,a[rel~=\"tag\"]")
+        |> Floki.filter_out("a.mention,a.hashtag,a.attachment,a[rel~=\"tag\"]")
         |> Floki.attribute("a", "href")
         |> Enum.at(0)
 

lib/pleroma/http/adapter_helper.ex

@@ -3,32 +3,30 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Pleroma.HTTP.AdapterHelper do
-  alias Pleroma.HTTP.Connection
+  @moduledoc """
+  Configure Tesla.Client with default and customized adapter options.
+  """
+  @defaults [pool: :federation]
+
+  @type proxy_type() :: :socks4 | :socks5
+  @type host() :: charlist() | :inet.ip_address()
+
+  alias Pleroma.Config
+  alias Pleroma.HTTP.AdapterHelper
+  require Logger
 
   @type proxy ::
           {Connection.host(), pos_integer()}
           | {Connection.proxy_type(), Connection.host(), pos_integer()}
 
   @callback options(keyword(), URI.t()) :: keyword()
-  @callback after_request(keyword()) :: :ok
+  @callback get_conn(URI.t(), keyword()) :: {:ok, term()} | {:error, term()}
-
-  @spec options(keyword(), URI.t()) :: keyword()
-  def options(opts, _uri) do
-    proxy = Pleroma.Config.get([:http, :proxy_url], nil)
-    maybe_add_proxy(opts, format_proxy(proxy))
-  end
-
-  @spec maybe_get_conn(URI.t(), keyword()) :: keyword()
-  def maybe_get_conn(_uri, opts), do: opts
-
-  @spec after_request(keyword()) :: :ok
-  def after_request(_opts), do: :ok
 
   @spec format_proxy(String.t() | tuple() | nil) :: proxy() | nil
   def format_proxy(nil), do: nil
 
   def format_proxy(proxy_url) do
-    case Connection.parse_proxy(proxy_url) do
+    case parse_proxy(proxy_url) do
       {:ok, host, port} -> {host, port}
       {:ok, type, host, port} -> {type, host, port}
       _ -> nil
@@ -38,4 +36,105 @@ defmodule Pleroma.HTTP.AdapterHelper do
   @spec maybe_add_proxy(keyword(), proxy() | nil) :: keyword()
   def maybe_add_proxy(opts, nil), do: opts
   def maybe_add_proxy(opts, proxy), do: Keyword.put_new(opts, :proxy, proxy)
+
+  @doc """
+  Merge default connection & adapter options with received ones.
+  """
+
+  @spec options(URI.t(), keyword()) :: keyword()
+  def options(%URI{} = uri, opts \\ []) do
+    @defaults
+    |> put_timeout()
+    |> Keyword.merge(opts)
+    |> adapter_helper().options(uri)
+  end
+
+  # For Hackney, this is the time a connection can stay idle in the pool.
+  # For Gun, this is the timeout to receive a message from Gun.
+  defp put_timeout(opts) do
+    {config_key, default} =
+      if adapter() == Tesla.Adapter.Gun do
+        {:pools, Config.get([:pools, :default, :timeout], 5_000)}
+      else
+        {:hackney_pools, 10_000}
+      end
+
+    timeout = Config.get([config_key, opts[:pool], :timeout], default)
+
+    Keyword.merge(opts, timeout: timeout)
+  end
+
+  def get_conn(uri, opts), do: adapter_helper().get_conn(uri, opts)
+  defp adapter, do: Application.get_env(:tesla, :adapter)
+
+  defp adapter_helper do
+    case adapter() do
+      Tesla.Adapter.Gun -> AdapterHelper.Gun
+      Tesla.Adapter.Hackney -> AdapterHelper.Hackney
+      _ -> AdapterHelper.Default
+    end
+  end
+
+  @spec parse_proxy(String.t() | tuple() | nil) ::
+          {:ok, host(), pos_integer()}
+          | {:ok, proxy_type(), host(), pos_integer()}
+          | {:error, atom()}
+          | nil
+
+  def parse_proxy(nil), do: nil
+
+  def parse_proxy(proxy) when is_binary(proxy) do
+    with [host, port] <- String.split(proxy, ":"),
+         {port, ""} <- Integer.parse(port) do
+      {:ok, parse_host(host), port}
+    else
+      {_, _} ->
+        Logger.warn("Parsing port failed #{inspect(proxy)}")
+        {:error, :invalid_proxy_port}
+
+      :error ->
+        Logger.warn("Parsing port failed #{inspect(proxy)}")
+        {:error, :invalid_proxy_port}
+
+      _ ->
+        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
+        {:error, :invalid_proxy}
+    end
+  end
+
+  def parse_proxy(proxy) when is_tuple(proxy) do
+    with {type, host, port} <- proxy do
+      {:ok, type, parse_host(host), port}
+    else
+      _ ->
+        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
+        {:error, :invalid_proxy}
+    end
+  end
+
+  @spec parse_host(String.t() | atom() | charlist()) :: charlist() | :inet.ip_address()
+  def parse_host(host) when is_list(host), do: host
+  def parse_host(host) when is_atom(host), do: to_charlist(host)
+
+  def parse_host(host) when is_binary(host) do
+    host = to_charlist(host)
+
+    case :inet.parse_address(host) do
+      {:error, :einval} -> host
+      {:ok, ip} -> ip
+    end
+  end
+
+  @spec format_host(String.t()) :: charlist()
+  def format_host(host) do
+    host_charlist = to_charlist(host)
+
+    case :inet.parse_address(host_charlist) do
+      {:error, :einval} ->
+        :idna.encode(host_charlist)
+
+      {:ok, _ip} ->
+        host_charlist
+    end
+  end
 end

lib/pleroma/http/adapter_helper/default.ex

@@ -0,0 +1,14 @@
+defmodule Pleroma.HTTP.AdapterHelper.Default do
+  alias Pleroma.HTTP.AdapterHelper
+
+  @behaviour Pleroma.HTTP.AdapterHelper
+
+  @spec options(keyword(), URI.t()) :: keyword()
+  def options(opts, _uri) do
+    proxy = Pleroma.Config.get([:http, :proxy_url], nil)
+    AdapterHelper.maybe_add_proxy(opts, AdapterHelper.format_proxy(proxy))
+  end
+
+  @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()}
+  def get_conn(_uri, opts), do: {:ok, opts}
+end

lib/pleroma/http/adapter_helper/gun.ex

@@ -5,8 +5,8 @@
 defmodule Pleroma.HTTP.AdapterHelper.Gun do
   @behaviour Pleroma.HTTP.AdapterHelper
 
+  alias Pleroma.Gun.ConnectionPool
   alias Pleroma.HTTP.AdapterHelper
-  alias Pleroma.Pool.Connections
 
   require Logger
 
@@ -14,7 +14,7 @@ defmodule Pleroma.HTTP.AdapterHelper.Gun do
     connect_timeout: 5_000,
     domain_lookup_timeout: 5_000,
     tls_handshake_timeout: 5_000,
-    retry: 1,
+    retry: 0,
     retry_timeout: 1000,
     await_up_timeout: 5_000
   ]
@@ -31,16 +31,7 @@ defmodule Pleroma.HTTP.AdapterHelper.Gun do
     |> Keyword.merge(config_opts)
     |> add_scheme_opts(uri)
     |> AdapterHelper.maybe_add_proxy(proxy)
-    |> maybe_get_conn(uri, incoming_opts)
+    |> Keyword.merge(incoming_opts)
-  end
-
-  @spec after_request(keyword()) :: :ok
-  def after_request(opts) do
-    if opts[:conn] && opts[:body_as] != :chunks do
-      Connections.checkout(opts[:conn], self(), :gun_connections)
-    end
-
-    :ok
   end
 
   defp add_scheme_opts(opts, %{scheme: "http"}), do: opts
@@ -48,30 +39,40 @@ defmodule Pleroma.HTTP.AdapterHelper.Gun do
   defp add_scheme_opts(opts, %{scheme: "https"}) do
     opts
     |> Keyword.put(:certificates_verification, true)
-    |> Keyword.put(:tls_opts, log_level: :warning)
   end
 
-  defp maybe_get_conn(adapter_opts, uri, incoming_opts) do
+  @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()} | {:error, atom()}
-    {receive_conn?, opts} =
+  def get_conn(uri, opts) do
-      adapter_opts
+    case ConnectionPool.get_conn(uri, opts) do
-      |> Keyword.merge(incoming_opts)
+      {:ok, conn_pid} -> {:ok, Keyword.merge(opts, conn: conn_pid, close_conn: false)}
-      |> Keyword.pop(:receive_conn, true)
+      err -> err
-
-    if Connections.alive?(:gun_connections) and receive_conn? do
-      checkin_conn(uri, opts)
-    else
-      opts
     end
   end
 
-  defp checkin_conn(uri, opts) do
+  @prefix Pleroma.Gun.ConnectionPool
-    case Connections.checkin(uri, :gun_connections) do
+  def limiter_setup do
-      nil ->
+    wait = Pleroma.Config.get([:connections_pool, :connection_acquisition_wait])
-        Task.start(Pleroma.Gun.Conn, :open, [uri, :gun_connections, opts])
+    retries = Pleroma.Config.get([:connections_pool, :connection_acquisition_retries])
-        opts
 
-      conn when is_pid(conn) ->
+    :pools
-        Keyword.merge(opts, conn: conn, close_conn: false)
+    |> Pleroma.Config.get([])
-    end
+    |> Enum.each(fn {name, opts} ->
+      max_running = Keyword.get(opts, :size, 50)
+      max_waiting = Keyword.get(opts, :max_waiting, 10)
+
+      result =
+        ConcurrentLimiter.new(:"#{@prefix}.#{name}", max_running, max_waiting,
+          wait: wait,
+          max_retries: retries
+        )
+
+      case result do
+        :ok -> :ok
+        {:error, :existing} -> :ok
+        e -> raise e
+      end
+    end)
+
+    :ok
   end
 end

lib/pleroma/http/adapter_helper/hackney.ex

@@ -24,5 +24,6 @@ defmodule Pleroma.HTTP.AdapterHelper.Hackney do
 
   defp add_scheme_opts(opts, _), do: opts
 
-  def after_request(_), do: :ok
+  @spec get_conn(URI.t(), keyword()) :: {:ok, keyword()}
+  def get_conn(_uri, opts), do: {:ok, opts}
 end

lib/pleroma/http/connection.ex

@@ -1,124 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.HTTP.Connection do
-  @moduledoc """
-  Configure Tesla.Client with default and customized adapter options.
-  """
-
-  alias Pleroma.Config
-  alias Pleroma.HTTP.AdapterHelper
-
-  require Logger
-
-  @defaults [pool: :federation]
-
-  @type ip_address :: ipv4_address() | ipv6_address()
-  @type ipv4_address :: {0..255, 0..255, 0..255, 0..255}
-  @type ipv6_address ::
-          {0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535, 0..65_535}
-  @type proxy_type() :: :socks4 | :socks5
-  @type host() :: charlist() | ip_address()
-
-  @doc """
-  Merge default connection & adapter options with received ones.
-  """
-
-  @spec options(URI.t(), keyword()) :: keyword()
-  def options(%URI{} = uri, opts \\ []) do
-    @defaults
-    |> pool_timeout()
-    |> Keyword.merge(opts)
-    |> adapter_helper().options(uri)
-  end
-
-  defp pool_timeout(opts) do
-    {config_key, default} =
-      if adapter() == Tesla.Adapter.Gun do
-        {:pools, Config.get([:pools, :default, :timeout])}
-      else
-        {:hackney_pools, 10_000}
-      end
-
-    timeout = Config.get([config_key, opts[:pool], :timeout], default)
-
-    Keyword.merge(opts, timeout: timeout)
-  end
-
-  @spec after_request(keyword()) :: :ok
-  def after_request(opts), do: adapter_helper().after_request(opts)
-
-  defp adapter, do: Application.get_env(:tesla, :adapter)
-
-  defp adapter_helper do
-    case adapter() do
-      Tesla.Adapter.Gun -> AdapterHelper.Gun
-      Tesla.Adapter.Hackney -> AdapterHelper.Hackney
-      _ -> AdapterHelper
-    end
-  end
-
-  @spec parse_proxy(String.t() | tuple() | nil) ::
-          {:ok, host(), pos_integer()}
-          | {:ok, proxy_type(), host(), pos_integer()}
-          | {:error, atom()}
-          | nil
-
-  def parse_proxy(nil), do: nil
-
-  def parse_proxy(proxy) when is_binary(proxy) do
-    with [host, port] <- String.split(proxy, ":"),
-         {port, ""} <- Integer.parse(port) do
-      {:ok, parse_host(host), port}
-    else
-      {_, _} ->
-        Logger.warn("Parsing port failed #{inspect(proxy)}")
-        {:error, :invalid_proxy_port}
-
-      :error ->
-        Logger.warn("Parsing port failed #{inspect(proxy)}")
-        {:error, :invalid_proxy_port}
-
-      _ ->
-        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
-        {:error, :invalid_proxy}
-    end
-  end
-
-  def parse_proxy(proxy) when is_tuple(proxy) do
-    with {type, host, port} <- proxy do
-      {:ok, type, parse_host(host), port}
-    else
-      _ ->
-        Logger.warn("Parsing proxy failed #{inspect(proxy)}")
-        {:error, :invalid_proxy}
-    end
-  end
-
-  @spec parse_host(String.t() | atom() | charlist()) :: charlist() | ip_address()
-  def parse_host(host) when is_list(host), do: host
-  def parse_host(host) when is_atom(host), do: to_charlist(host)
-
-  def parse_host(host) when is_binary(host) do
-    host = to_charlist(host)
-
-    case :inet.parse_address(host) do
-      {:error, :einval} -> host
-      {:ok, ip} -> ip
-    end
-  end
-
-  @spec format_host(String.t()) :: charlist()
-  def format_host(host) do
-    host_charlist = to_charlist(host)
-
-    case :inet.parse_address(host_charlist) do
-      {:error, :einval} ->
-        :idna.encode(host_charlist)
-
-      {:ok, _ip} ->
-        host_charlist
-    end
-  end
-end

lib/pleroma/http/http.ex

@@ -7,7 +7,7 @@ defmodule Pleroma.HTTP do
     Wrapper for `Tesla.request/2`.
   """
 
-  alias Pleroma.HTTP.Connection
+  alias Pleroma.HTTP.AdapterHelper
   alias Pleroma.HTTP.Request
   alias Pleroma.HTTP.RequestBuilder, as: Builder
   alias Tesla.Client
@@ -60,49 +60,29 @@ defmodule Pleroma.HTTP do
           {:ok, Env.t()} | {:error, any()}
   def request(method, url, body, headers, options) when is_binary(url) do
     uri = URI.parse(url)
-    adapter_opts = Connection.options(uri, options[:adapter] || [])
+    adapter_opts = AdapterHelper.options(uri, options[:adapter] || [])
+
+    case AdapterHelper.get_conn(uri, adapter_opts) do
+      {:ok, adapter_opts} ->
         options = put_in(options[:adapter], adapter_opts)
         params = options[:params] || []
         request = build_request(method, headers, options, url, body, params)
 
         adapter = Application.get_env(:tesla, :adapter)
-    client = Tesla.client([Tesla.Middleware.FollowRedirects], adapter)
+        client = Tesla.client([Pleroma.HTTP.Middleware.FollowRedirects], adapter)
 
-    pid = Process.whereis(adapter_opts[:pool])
+        maybe_limit(
-
+          fn ->
-    pool_alive? =
+            request(client, request)
-      if adapter == Tesla.Adapter.Gun && pid do
+          end,
-        Process.alive?(pid)
+          adapter,
-      else
-        false
-      end
-
-    request_opts =
           adapter_opts
-      |> Enum.into(%{})
-      |> Map.put(:env, Pleroma.Config.get([:env]))
-      |> Map.put(:pool_alive?, pool_alive?)
-
-    response = request(client, request, request_opts)
-
-    Connection.after_request(adapter_opts)
-
-    response
-  end
-
-  @spec request(Client.t(), keyword(), map()) :: {:ok, Env.t()} | {:error, any()}
-  def request(%Client{} = client, request, %{env: :test}), do: request(client, request)
-
-  def request(%Client{} = client, request, %{body_as: :chunks}), do: request(client, request)
-
-  def request(%Client{} = client, request, %{pool_alive?: false}), do: request(client, request)
-
-  def request(%Client{} = client, request, %{pool: pool, timeout: timeout}) do
-    :poolboy.transaction(
-      pool,
-      &Pleroma.Pool.Request.execute(&1, client, request, timeout),
-      timeout
         )
+
+      # Connection release is handled in a custom FollowRedirects middleware
+      err ->
+        err
+    end
   end
 
   @spec request(Client.t(), keyword()) :: {:ok, Env.t()} | {:error, any()}
@@ -118,4 +98,13 @@ defmodule Pleroma.HTTP do
     |> Builder.add_param(:query, :query, params)
     |> Builder.convert_to_keyword()
   end
+
+  @prefix Pleroma.Gun.ConnectionPool
+  defp maybe_limit(fun, Tesla.Adapter.Gun, opts) do
+    ConcurrentLimiter.limit(:"#{@prefix}.#{opts[:pool] || :default}", fun)
+  end
+
+  defp maybe_limit(fun, _, _) do
+    fun.()
+  end
 end

lib/pleroma/instances/instance.ex

@@ -17,6 +17,8 @@ defmodule Pleroma.Instances.Instance do
   schema "instances" do
     field(:host, :string)
     field(:unreachable_since, :naive_datetime_usec)
+    field(:favicon, :string)
+    field(:favicon_updated_at, :naive_datetime)
 
     timestamps()
   end
@@ -25,7 +27,7 @@ defmodule Pleroma.Instances.Instance do
 
   def changeset(struct, params \\ %{}) do
     struct
-    |> cast(params, [:host, :unreachable_since])
+    |> cast(params, [:host, :unreachable_since, :favicon, :favicon_updated_at])
     |> validate_required([:host])
     |> unique_constraint(:host)
   end
@@ -120,4 +122,48 @@ defmodule Pleroma.Instances.Instance do
   end
 
   defp parse_datetime(datetime), do: datetime
+
+  def get_or_update_favicon(%URI{host: host} = instance_uri) do
+    existing_record = Repo.get_by(Instance, %{host: host})
+    now = NaiveDateTime.utc_now()
+
+    if existing_record && existing_record.favicon_updated_at &&
+         NaiveDateTime.diff(now, existing_record.favicon_updated_at) < 86_400 do
+      existing_record.favicon
+    else
+      favicon = scrape_favicon(instance_uri)
+
+      if existing_record do
+        existing_record
+        |> changeset(%{favicon: favicon, favicon_updated_at: now})
+        |> Repo.update()
+      else
+        %Instance{}
+        |> changeset(%{host: host, favicon: favicon, favicon_updated_at: now})
+        |> Repo.insert()
+      end
+
+      favicon
+    end
+  end
+
+  defp scrape_favicon(%URI{} = instance_uri) do
+    try do
+      with {:ok, %Tesla.Env{body: html}} <-
+             Pleroma.HTTP.get(to_string(instance_uri), [{:Accept, "text/html"}]),
+           favicon_rel <-
+             html
+             |> Floki.parse_document!()
+             |> Floki.attribute("link[rel=icon]", "href")
+             |> List.first(),
+           favicon <- URI.merge(instance_uri, favicon_rel) |> to_string(),
+           true <- is_binary(favicon) do
+        favicon
+      else
+        _ -> nil
+      end
+    rescue
+      _ -> nil
+    end
+  end
 end

lib/pleroma/migration_helper/notification_backfill.ex

@@ -3,7 +3,6 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Pleroma.MigrationHelper.NotificationBackfill do
-  alias Pleroma.Notification
   alias Pleroma.Object
   alias Pleroma.Repo
   alias Pleroma.User
@@ -25,18 +24,27 @@ defmodule Pleroma.MigrationHelper.NotificationBackfill do
         |> type_from_activity()
 
       notification
-      |> Notification.changeset(%{type: type})
+      |> Ecto.Changeset.change(%{type: type})
       |> Repo.update()
     end)
   end
 
+  defp get_by_ap_id(ap_id) do
+    q =
+      from(u in User,
+        select: u.id
+      )
+
+    Repo.get_by(q, ap_id: ap_id)
+  end
+
   # This is copied over from Notifications to keep this stable.
   defp type_from_activity(%{data: %{"type" => type}} = activity) do
     case type do
       "Follow" ->
         accepted_function = fn activity ->
-          with %User{} = follower <- User.get_by_ap_id(activity.data["actor"]),
+          with %User{} = follower <- get_by_ap_id(activity.data["actor"]),
-               %User{} = followed <- User.get_by_ap_id(activity.data["object"]) do
+               %User{} = followed <- get_by_ap_id(activity.data["object"]) do
             Pleroma.FollowingRelationship.following?(follower, followed)
           end
         end

lib/pleroma/notification.ex

@@ -130,6 +130,7 @@ defmodule Pleroma.Notification do
     |> preload([n, a, o], activity: {a, object: o})
     |> exclude_notification_muted(user, exclude_notification_muted_opts)
     |> exclude_blocked(user, exclude_blocked_opts)
+    |> exclude_filtered(user)
     |> exclude_visibility(opts)
   end
 
@@ -158,6 +159,20 @@ defmodule Pleroma.Notification do
     |> where([n, a, o, tm], is_nil(tm.user_id))
   end
 
+  defp exclude_filtered(query, user) do
+    case Pleroma.Filter.compose_regex(user) do
+      nil ->
+        query
+
+      regex ->
+        from([_n, a, o] in query,
+          where:
+            fragment("not(?->>'content' ~* ?)", o.data, ^regex) or
+              fragment("?->>'actor' = ?", o.data, ^user.ap_id)
+        )
+    end
+  end
+
   @valid_visibilities ~w[direct unlisted public private]
 
   defp exclude_visibility(query, %{exclude_visibilities: visibility})
@@ -337,6 +352,7 @@ defmodule Pleroma.Notification do
     end
   end
 
+  @spec create_notifications(Activity.t(), keyword()) :: {:ok, [Notification.t()] | []}
   def create_notifications(activity, options \\ [])
 
   def create_notifications(%Activity{data: %{"to" => _, "type" => "Create"}} = activity, options) do
@@ -367,6 +383,7 @@ defmodule Pleroma.Notification do
         do_send = do_send && user in enabled_receivers
         create_notification(activity, user, do_send)
       end)
+      |> Enum.reject(&is_nil/1)
 
     {:ok, notifications}
   end
@@ -480,6 +497,10 @@ defmodule Pleroma.Notification do
     end
   end
 
+  def get_potential_receiver_ap_ids(%{data: %{"type" => "Follow", "object" => object_id}}) do
+    [object_id]
+  end
+
   def get_potential_receiver_ap_ids(activity) do
     []
     |> Utils.maybe_notify_to_recipients(activity)
@@ -550,11 +571,9 @@ defmodule Pleroma.Notification do
     [
       :self,
       :invisible,
-      :followers,
+      :block_from_strangers,
-      :follows,
+      :recently_followed,
-      :non_followers,
+      :filtered
-      :non_follows,
-      :recently_followed
     ]
     |> Enum.find(&skip?(&1, activity, user))
   end
@@ -573,45 +592,15 @@ defmodule Pleroma.Notification do
   end
 
   def skip?(
-        :followers,
+        :block_from_strangers,
         %Activity{} = activity,
-        %User{notification_settings: %{followers: false}} = user
+        %User{notification_settings: %{block_from_strangers: true}} = user
-      ) do
-    actor = activity.data["actor"]
-    follower = User.get_cached_by_ap_id(actor)
-    User.following?(follower, user)
-  end
-
-  def skip?(
-        :non_followers,
-        %Activity{} = activity,
-        %User{notification_settings: %{non_followers: false}} = user
       ) do
     actor = activity.data["actor"]
     follower = User.get_cached_by_ap_id(actor)
     !User.following?(follower, user)
   end
 
-  def skip?(
-        :follows,
-        %Activity{} = activity,
-        %User{notification_settings: %{follows: false}} = user
-      ) do
-    actor = activity.data["actor"]
-    followed = User.get_cached_by_ap_id(actor)
-    User.following?(user, followed)
-  end
-
-  def skip?(
-        :non_follows,
-        %Activity{} = activity,
-        %User{notification_settings: %{non_follows: false}} = user
-      ) do
-    actor = activity.data["actor"]
-    followed = User.get_cached_by_ap_id(actor)
-    !User.following?(user, followed)
-  end
-
   # To do: consider defining recency in hours and checking FollowingRelationship with a single SQL
   def skip?(:recently_followed, %Activity{data: %{"type" => "Follow"}} = activity, %User{} = user) do
     actor = activity.data["actor"]
@@ -623,6 +612,26 @@ defmodule Pleroma.Notification do
     end)
   end
 
+  def skip?(:filtered, %{data: %{"type" => type}}, _) when type in ["Follow", "Move"], do: false
+
+  def skip?(:filtered, activity, user) do
+    object = Object.normalize(activity)
+
+    cond do
+      is_nil(object) ->
+        false
+
+      object.data["actor"] == user.ap_id ->
+        false
+
+      not is_nil(regex = Pleroma.Filter.compose_regex(user, :re)) ->
+        Regex.match?(regex, object.data["content"])
+
+      true ->
+        false
+    end
+  end
+
   def skip?(_, _, _), do: false
 
   def for_user_and_activity(user, activity) do

lib/pleroma/object/fetcher.ex

@@ -83,8 +83,8 @@ defmodule Pleroma.Object.Fetcher do
       {:transmogrifier, {:error, {:reject, nil}}} ->
         {:reject, nil}
 
-      {:transmogrifier, _} ->
+      {:transmogrifier, _} = e ->
-        {:error, "Transmogrifier failure."}
+        {:error, e}
 
       {:object, data, nil} ->
         reinject_object(%Object{}, data)

lib/pleroma/plugs/admin_secret_authentication_plug.ex

@@ -4,6 +4,9 @@
 
 defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
   import Plug.Conn
+
+  alias Pleroma.Plugs.OAuthScopesPlug
+  alias Pleroma.Plugs.RateLimiter
   alias Pleroma.User
 
   def init(options) do
@@ -11,7 +14,10 @@ defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
   end
 
   def secret_token do
-    Pleroma.Config.get(:admin_token)
+    case Pleroma.Config.get(:admin_token) do
+      blank when blank in [nil, ""] -> nil
+      token -> token
+    end
   end
 
   def call(%{assigns: %{user: %User{}}} = conn, _), do: conn
@@ -26,9 +32,9 @@ defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
 
   def authenticate(%{params: %{"admin_token" => admin_token}} = conn) do
     if admin_token == secret_token() do
-      assign(conn, :user, %User{is_admin: true})
+      assign_admin_user(conn)
     else
-      conn
+      handle_bad_token(conn)
     end
   end
 
@@ -36,8 +42,19 @@ defmodule Pleroma.Plugs.AdminSecretAuthenticationPlug do
     token = secret_token()
 
     case get_req_header(conn, "x-admin-token") do
-      [^token] -> assign(conn, :user, %User{is_admin: true})
+      blank when blank in [[], [""]] -> conn
-      _ -> conn
+      [^token] -> assign_admin_user(conn)
+      _ -> handle_bad_token(conn)
     end
   end
+
+  defp assign_admin_user(conn) do
+    conn
+    |> assign(:user, %User{is_admin: true})
+    |> OAuthScopesPlug.skip_plug()
+  end
+
+  defp handle_bad_token(conn) do
+    RateLimiter.call(conn, name: :authentication)
+  end
 end

lib/pleroma/plugs/http_security_plug.ex

@@ -69,10 +69,11 @@ defmodule Pleroma.Plugs.HTTPSecurityPlug do
     img_src = "img-src 'self' data: blob:"
     media_src = "media-src 'self'"
 
+    # Strict multimedia CSP enforcement only when MediaProxy is enabled
     {img_src, media_src} =
       if Config.get([:media_proxy, :enabled]) &&
            !Config.get([:media_proxy, :proxy_opts, :redirect_on_failure]) do
-        sources = get_proxy_and_attachment_sources()
+        sources = build_csp_multimedia_source_list()
         {[img_src, sources], [media_src, sources]}
       else
         {[img_src, " https:"], [media_src, " https:"]}
@@ -81,14 +82,14 @@ defmodule Pleroma.Plugs.HTTPSecurityPlug do
     connect_src = ["connect-src 'self' blob: ", static_url, ?\s, websocket_url]
 
     connect_src =
-      if Pleroma.Config.get(:env) == :dev do
+      if Config.get(:env) == :dev do
         [connect_src, " http://localhost:3035/"]
       else
         connect_src
       end
 
     script_src =
-      if Pleroma.Config.get(:env) == :dev do
+      if Config.get(:env) == :dev do
         "script-src 'self' 'unsafe-eval'"
       else
         "script-src 'self'"
@@ -107,38 +108,64 @@ defmodule Pleroma.Plugs.HTTPSecurityPlug do
     |> :erlang.iolist_to_binary()
   end
 
-  defp get_proxy_and_attachment_sources do
+  defp build_csp_from_whitelist([], acc), do: acc
+
+  defp build_csp_from_whitelist([last], acc) do
+    [build_csp_param_from_whitelist(last) | acc]
+  end
+
+  defp build_csp_from_whitelist([head | tail], acc) do
+    build_csp_from_whitelist(tail, [[?\s, build_csp_param_from_whitelist(head)] | acc])
+  end
+
+  # TODO: use `build_csp_param/1` after removing support bare domains for media proxy whitelist
+  defp build_csp_param_from_whitelist("http" <> _ = url) do
+    build_csp_param(url)
+  end
+
+  defp build_csp_param_from_whitelist(url), do: url
+
+  defp build_csp_multimedia_source_list do
     media_proxy_whitelist =
-      Enum.reduce(Config.get([:media_proxy, :whitelist]), [], fn host, acc ->
+      [:media_proxy, :whitelist]
-        add_source(acc, host)
+      |> Config.get()
-      end)
+      |> build_csp_from_whitelist([])
 
-    media_proxy_base_url =
+    captcha_method = Config.get([Pleroma.Captcha, :method])
-      if Config.get([:media_proxy, :base_url]),
+    captcha_endpoint = Config.get([captcha_method, :endpoint])
-        do: URI.parse(Config.get([:media_proxy, :base_url])).host
 
-    upload_base_url =
+    base_endpoints =
-      if Config.get([Pleroma.Upload, :base_url]),
+      [
-        do: URI.parse(Config.get([Pleroma.Upload, :base_url])).host
+        [:media_proxy, :base_url],
+        [Pleroma.Upload, :base_url],
+        [Pleroma.Uploaders.S3, :public_endpoint]
+      ]
+      |> Enum.map(&Config.get/1)
 
-    s3_endpoint =
+    [captcha_endpoint | base_endpoints]
-      if Config.get([Pleroma.Upload, :uploader]) == Pleroma.Uploaders.S3,
+    |> Enum.map(&build_csp_param/1)
-        do: URI.parse(Config.get([Pleroma.Uploaders.S3, :public_endpoint])).host
+    |> Enum.reduce([], &add_source(&2, &1))
-
-    []
-    |> add_source(media_proxy_base_url)
-    |> add_source(upload_base_url)
-    |> add_source(s3_endpoint)
     |> add_source(media_proxy_whitelist)
   end
 
   defp add_source(iodata, nil), do: iodata
+  defp add_source(iodata, []), do: iodata
   defp add_source(iodata, source), do: [[?\s, source] | iodata]
 
   defp add_csp_param(csp_iodata, nil), do: csp_iodata
 
   defp add_csp_param(csp_iodata, param), do: [[param, ?;] | csp_iodata]
 
+  defp build_csp_param(nil), do: nil
+
+  defp build_csp_param(url) when is_binary(url) do
+    %{host: host, scheme: scheme} = URI.parse(url)
+
+    if scheme do
+      [scheme, "://", host]
+    end
+  end
+
   def warn_if_disabled do
     unless Config.get([:http_security, :enabled]) do
       Logger.warn("

lib/pleroma/plugs/static_fe_plug.ex

@@ -9,7 +9,7 @@ defmodule Pleroma.Plugs.StaticFEPlug do
   def init(options), do: options
 
   def call(conn, _) do
-    if enabled?() and accepts_html?(conn) do
+    if enabled?() and requires_html?(conn) do
       conn
       |> StaticFEController.call(:show)
       |> halt()
@@ -20,10 +20,7 @@ defmodule Pleroma.Plugs.StaticFEPlug do
 
   defp enabled?, do: Pleroma.Config.get([:static_fe, :enabled], false)
 
-  defp accepts_html?(conn) do
+  defp requires_html?(conn) do
-    case get_req_header(conn, "accept") do
+    Phoenix.Controller.get_format(conn) == "html"
-      [accept | _] -> String.contains?(accept, "text/html")
-      _ -> false
-    end
   end
 end

lib/pleroma/plugs/user_is_admin_plug.ex

@@ -7,37 +7,18 @@ defmodule Pleroma.Plugs.UserIsAdminPlug do
   import Plug.Conn
 
   alias Pleroma.User
-  alias Pleroma.Web.OAuth
 
   def init(options) do
     options
   end
 
-  def call(%{assigns: %{user: %User{is_admin: true}} = assigns} = conn, _) do
+  def call(%{assigns: %{user: %User{is_admin: true}}} = conn, _) do
-    token = assigns[:token]
-
-    cond do
-      not Pleroma.Config.enforce_oauth_admin_scope_usage?() ->
     conn
-
-      token && OAuth.Scopes.contains_admin_scopes?(token.scopes) ->
-        # Note: checking for _any_ admin scope presence, not necessarily fitting requested action.
-        #   Thus, controller must explicitly invoke OAuthScopesPlug to verify scope requirements.
-        #   Admin might opt out of admin scope for some apps to block any admin actions from them.
-        conn
-
-      true ->
-        fail(conn)
-    end
   end
 
   def call(conn, _) do
-    fail(conn)
-  end
-
-  defp fail(conn) do
     conn
-    |> render_error(:forbidden, "User is not an admin or OAuth admin scope is not granted.")
+    |> render_error(:forbidden, "User is not an admin.")
     |> halt()
   end
 end

lib/pleroma/pool/connections.ex

@@ -1,283 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool.Connections do
-  use GenServer
-
-  alias Pleroma.Config
-  alias Pleroma.Gun
-
-  require Logger
-
-  @type domain :: String.t()
-  @type conn :: Pleroma.Gun.Conn.t()
-
-  @type t :: %__MODULE__{
-          conns: %{domain() => conn()},
-          opts: keyword()
-        }
-
-  defstruct conns: %{}, opts: []
-
-  @spec start_link({atom(), keyword()}) :: {:ok, pid()}
-  def start_link({name, opts}) do
-    GenServer.start_link(__MODULE__, opts, name: name)
-  end
-
-  @impl true
-  def init(opts), do: {:ok, %__MODULE__{conns: %{}, opts: opts}}
-
-  @spec checkin(String.t() | URI.t(), atom()) :: pid() | nil
-  def checkin(url, name)
-  def checkin(url, name) when is_binary(url), do: checkin(URI.parse(url), name)
-
-  def checkin(%URI{} = uri, name) do
-    timeout = Config.get([:connections_pool, :checkin_timeout], 250)
-
-    GenServer.call(name, {:checkin, uri}, timeout)
-  end
-
-  @spec alive?(atom()) :: boolean()
-  def alive?(name) do
-    if pid = Process.whereis(name) do
-      Process.alive?(pid)
-    else
-      false
-    end
-  end
-
-  @spec get_state(atom()) :: t()
-  def get_state(name) do
-    GenServer.call(name, :state)
-  end
-
-  @spec count(atom()) :: pos_integer()
-  def count(name) do
-    GenServer.call(name, :count)
-  end
-
-  @spec get_unused_conns(atom()) :: [{domain(), conn()}]
-  def get_unused_conns(name) do
-    GenServer.call(name, :unused_conns)
-  end
-
-  @spec checkout(pid(), pid(), atom()) :: :ok
-  def checkout(conn, pid, name) do
-    GenServer.cast(name, {:checkout, conn, pid})
-  end
-
-  @spec add_conn(atom(), String.t(), Pleroma.Gun.Conn.t()) :: :ok
-  def add_conn(name, key, conn) do
-    GenServer.cast(name, {:add_conn, key, conn})
-  end
-
-  @spec remove_conn(atom(), String.t()) :: :ok
-  def remove_conn(name, key) do
-    GenServer.cast(name, {:remove_conn, key})
-  end
-
-  @impl true
-  def handle_cast({:add_conn, key, conn}, state) do
-    state = put_in(state.conns[key], conn)
-
-    Process.monitor(conn.conn)
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_cast({:checkout, conn_pid, pid}, state) do
-    state =
-      with true <- Process.alive?(conn_pid),
-           {key, conn} <- find_conn(state.conns, conn_pid),
-           used_by <- List.keydelete(conn.used_by, pid, 0) do
-        conn_state = if used_by == [], do: :idle, else: conn.conn_state
-
-        put_in(state.conns[key], %{conn | conn_state: conn_state, used_by: used_by})
-      else
-        false ->
-          Logger.debug("checkout for closed conn #{inspect(conn_pid)}")
-          state
-
-        nil ->
-          Logger.debug("checkout for alive conn #{inspect(conn_pid)}, but is not in state")
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_cast({:remove_conn, key}, state) do
-    state = put_in(state.conns, Map.delete(state.conns, key))
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_call({:checkin, uri}, from, state) do
-    key = "#{uri.scheme}:#{uri.host}:#{uri.port}"
-
-    case state.conns[key] do
-      %{conn: pid, gun_state: :up} = conn ->
-        time = :os.system_time(:second)
-        last_reference = time - conn.last_reference
-        crf = crf(last_reference, 100, conn.crf)
-
-        state =
-          put_in(state.conns[key], %{
-            conn
-            | last_reference: time,
-              crf: crf,
-              conn_state: :active,
-              used_by: [from | conn.used_by]
-          })
-
-        {:reply, pid, state}
-
-      %{gun_state: :down} ->
-        {:reply, nil, state}
-
-      nil ->
-        {:reply, nil, state}
-    end
-  end
-
-  @impl true
-  def handle_call(:state, _from, state), do: {:reply, state, state}
-
-  @impl true
-  def handle_call(:count, _from, state) do
-    {:reply, Enum.count(state.conns), state}
-  end
-
-  @impl true
-  def handle_call(:unused_conns, _from, state) do
-    unused_conns =
-      state.conns
-      |> Enum.filter(&filter_conns/1)
-      |> Enum.sort(&sort_conns/2)
-
-    {:reply, unused_conns, state}
-  end
-
-  defp filter_conns({_, %{conn_state: :idle, used_by: []}}), do: true
-  defp filter_conns(_), do: false
-
-  defp sort_conns({_, c1}, {_, c2}) do
-    c1.crf <= c2.crf and c1.last_reference <= c2.last_reference
-  end
-
-  @impl true
-  def handle_info({:gun_up, conn_pid, _protocol}, state) do
-    %{origin_host: host, origin_scheme: scheme, origin_port: port} = Gun.info(conn_pid)
-
-    host =
-      case :inet.ntoa(host) do
-        {:error, :einval} -> host
-        ip -> ip
-      end
-
-    key = "#{scheme}:#{host}:#{port}"
-
-    state =
-      with {key, conn} <- find_conn(state.conns, conn_pid, key),
-           {true, key} <- {Process.alive?(conn_pid), key} do
-        put_in(state.conns[key], %{
-          conn
-          | gun_state: :up,
-            conn_state: :active,
-            retries: 0
-        })
-      else
-        {false, key} ->
-          put_in(
-            state.conns,
-            Map.delete(state.conns, key)
-          )
-
-        nil ->
-          :ok = Gun.close(conn_pid)
-
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_down, conn_pid, _protocol, _reason, _killed}, state) do
-    retries = Config.get([:connections_pool, :retry], 1)
-    # we can't get info on this pid, because pid is dead
-    state =
-      with {key, conn} <- find_conn(state.conns, conn_pid),
-           {true, key} <- {Process.alive?(conn_pid), key} do
-        if conn.retries == retries do
-          :ok = Gun.close(conn.conn)
-
-          put_in(
-            state.conns,
-            Map.delete(state.conns, key)
-          )
-        else
-          put_in(state.conns[key], %{
-            conn
-            | gun_state: :down,
-              retries: conn.retries + 1
-          })
-        end
-      else
-        {false, key} ->
-          put_in(
-            state.conns,
-            Map.delete(state.conns, key)
-          )
-
-        nil ->
-          Logger.debug(":gun_down for conn which isn't found in state")
-
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:DOWN, _ref, :process, conn_pid, reason}, state) do
-    Logger.debug("received DOWN message for #{inspect(conn_pid)} reason -> #{inspect(reason)}")
-
-    state =
-      with {key, conn} <- find_conn(state.conns, conn_pid) do
-        Enum.each(conn.used_by, fn {pid, _ref} ->
-          Process.exit(pid, reason)
-        end)
-
-        put_in(
-          state.conns,
-          Map.delete(state.conns, key)
-        )
-      else
-        nil ->
-          Logger.debug(":DOWN for conn which isn't found in state")
-
-          state
-      end
-
-    {:noreply, state}
-  end
-
-  defp find_conn(conns, conn_pid) do
-    Enum.find(conns, fn {_key, conn} ->
-      conn.conn == conn_pid
-    end)
-  end
-
-  defp find_conn(conns, conn_pid, conn_key) do
-    Enum.find(conns, fn {key, conn} ->
-      key == conn_key and conn.conn == conn_pid
-    end)
-  end
-
-  def crf(current, steps, crf) do
-    1 + :math.pow(0.5, current / steps) * crf
-  end
-end

lib/pleroma/pool/pool.ex

@@ -1,22 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool do
-  def child_spec(opts) do
-    poolboy_opts =
-      opts
-      |> Keyword.put(:worker_module, Pleroma.Pool.Request)
-      |> Keyword.put(:name, {:local, opts[:name]})
-      |> Keyword.put(:size, opts[:size])
-      |> Keyword.put(:max_overflow, opts[:max_overflow])
-
-    %{
-      id: opts[:id] || {__MODULE__, make_ref()},
-      start: {:poolboy, :start_link, [poolboy_opts, [name: opts[:name]]]},
-      restart: :permanent,
-      shutdown: 5000,
-      type: :worker
-    }
-  end
-end

lib/pleroma/pool/request.ex

@@ -1,65 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool.Request do
-  use GenServer
-
-  require Logger
-
-  def start_link(args) do
-    GenServer.start_link(__MODULE__, args)
-  end
-
-  @impl true
-  def init(_), do: {:ok, []}
-
-  @spec execute(pid() | atom(), Tesla.Client.t(), keyword(), pos_integer()) ::
-          {:ok, Tesla.Env.t()} | {:error, any()}
-  def execute(pid, client, request, timeout) do
-    GenServer.call(pid, {:execute, client, request}, timeout)
-  end
-
-  @impl true
-  def handle_call({:execute, client, request}, _from, state) do
-    response = Pleroma.HTTP.request(client, request)
-
-    {:reply, response, state}
-  end
-
-  @impl true
-  def handle_info({:gun_data, _conn, _stream, _, _}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_up, _conn, _protocol}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_down, _conn, _protocol, _reason, _killed}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_error, _conn, _stream, _error}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_push, _conn, _stream, _new_stream, _method, _uri, _headers}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info({:gun_response, _conn, _stream, _, _status, _headers}, state) do
-    {:noreply, state}
-  end
-
-  @impl true
-  def handle_info(msg, state) do
-    Logger.warn("Received unexpected message #{inspect(__MODULE__)} #{inspect(msg)}")
-    {:noreply, state}
-  end
-end

lib/pleroma/pool/supervisor.ex

@@ -1,42 +0,0 @@
-# Pleroma: A lightweight social networking server
-# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
-# SPDX-License-Identifier: AGPL-3.0-only
-
-defmodule Pleroma.Pool.Supervisor do
-  use Supervisor
-
-  alias Pleroma.Config
-  alias Pleroma.Pool
-
-  def start_link(args) do
-    Supervisor.start_link(__MODULE__, args, name: __MODULE__)
-  end
-
-  def init(_) do
-    conns_child = %{
-      id: Pool.Connections,
-      start:
-        {Pool.Connections, :start_link, [{:gun_connections, Config.get([:connections_pool])}]}
-    }
-
-    Supervisor.init([conns_child | pools()], strategy: :one_for_one)
-  end
-
-  defp pools do
-    pools = Config.get(:pools)
-
-    pools =
-      if Config.get([Pleroma.Upload, :proxy_remote]) == false do
-        Keyword.delete(pools, :upload)
-      else
-        pools
-      end
-
-    for {pool_name, pool_opts} <- pools do
-      pool_opts
-      |> Keyword.put(:id, {Pool, pool_name})
-      |> Keyword.put(:name, pool_name)
-      |> Pool.child_spec()
-    end
-  end
-end

lib/pleroma/reverse_proxy/client/tesla.ex

@@ -48,7 +48,7 @@ defmodule Pleroma.ReverseProxy.Client.Tesla do
     # if there were redirects we need to checkout old conn
     conn = opts[:old_conn] || opts[:conn]
 
-    if conn, do: :ok = Pleroma.Pool.Connections.checkout(conn, self(), :gun_connections)
+    if conn, do: :ok = Pleroma.Gun.ConnectionPool.release_conn(conn)
 
     :done
   end

lib/pleroma/reverse_proxy/reverse_proxy.ex

@@ -3,12 +3,13 @@
 # SPDX-License-Identifier: AGPL-3.0-only
 
 defmodule Pleroma.ReverseProxy do
+  @range_headers ~w(range if-range)
   @keep_req_headers ~w(accept user-agent accept-encoding cache-control if-modified-since) ++
-                      ~w(if-unmodified-since if-none-match if-range range)
+                      ~w(if-unmodified-since if-none-match) ++ @range_headers
   @resp_cache_headers ~w(etag date last-modified)
   @keep_resp_headers @resp_cache_headers ++
-                       ~w(content-type content-disposition content-encoding content-range) ++
+                       ~w(content-length content-type content-disposition content-encoding) ++
-                       ~w(accept-ranges vary)
+                       ~w(content-range accept-ranges vary)
   @default_cache_control_header "public, max-age=1209600"
   @valid_resp_codes [200, 206, 304]
   @max_read_duration :timer.seconds(30)
@@ -170,6 +171,8 @@ defmodule Pleroma.ReverseProxy do
   end
 
   defp response(conn, client, url, status, headers, opts) do
+    Logger.debug("#{__MODULE__} #{status} #{url} #{inspect(headers)}")
+
     result =
       conn
       |> put_resp_headers(build_resp_headers(headers, opts))
@@ -220,7 +223,9 @@ defmodule Pleroma.ReverseProxy do
     end
   end
 
-  defp head_response(conn, _url, code, headers, opts) do
+  defp head_response(conn, url, code, headers, opts) do
+    Logger.debug("#{__MODULE__} #{code} #{url} #{inspect(headers)}")
+
     conn
     |> put_resp_headers(build_resp_headers(headers, opts))
     |> send_resp(code, "")
@@ -262,9 +267,23 @@ defmodule Pleroma.ReverseProxy do
     headers
     |> downcase_headers()
     |> Enum.filter(fn {k, _} -> k in @keep_req_headers end)
-    |> (fn headers ->
+    |> build_req_range_or_encoding_header(opts)
-          headers = headers ++ Keyword.get(opts, :req_headers, [])
+    |> build_req_user_agent_header(opts)
+    |> Keyword.merge(Keyword.get(opts, :req_headers, []))
+  end
 
+  # Disable content-encoding if any @range_headers are requested (see #1823).
+  defp build_req_range_or_encoding_header(headers, _opts) do
+    range? = Enum.any?(headers, fn {header, _} -> Enum.member?(@range_headers, header) end)
+
+    if range? && List.keymember?(headers, "accept-encoding", 0) do
+      List.keydelete(headers, "accept-encoding", 0)
+    else
+      headers
+    end
+  end
+
+  defp build_req_user_agent_header(headers, opts) do
     if Keyword.get(opts, :keep_user_agent, false) do
       List.keystore(
         headers,
@@ -275,7 +294,6 @@ defmodule Pleroma.ReverseProxy do
     else
       headers
     end
-        end).()
   end
 
   defp build_resp_headers(headers, opts) do
@@ -283,7 +301,7 @@ defmodule Pleroma.ReverseProxy do
     |> Enum.filter(fn {k, _} -> k in @keep_resp_headers end)
     |> build_resp_cache_headers(opts)
     |> build_resp_content_disposition_header(opts)
-    |> (fn headers -> headers ++ Keyword.get(opts, :resp_headers, []) end).()
+    |> Keyword.merge(Keyword.get(opts, :resp_headers, []))
   end
 
   defp build_resp_cache_headers(headers, _opts) do

lib/pleroma/telemetry/logger.ex

@@ -0,0 +1,76 @@
+defmodule Pleroma.Telemetry.Logger do
+  @moduledoc "Transforms Pleroma telemetry events to logs"
+
+  require Logger
+
+  @events [
+    [:pleroma, :connection_pool, :reclaim, :start],
+    [:pleroma, :connection_pool, :reclaim, :stop],
+    [:pleroma, :connection_pool, :provision_failure],
+    [:pleroma, :connection_pool, :client_death]
+  ]
+  def attach do
+    :telemetry.attach_many("pleroma-logger", @events, &handle_event/4, [])
+  end
+
+  # Passing anonymous functions instead of strings to logger is intentional,
+  # that way strings won't be concatenated if the message is going to be thrown
+  # out anyway due to higher log level configured
+
+  def handle_event(
+        [:pleroma, :connection_pool, :reclaim, :start],
+        _,
+        %{max_connections: max_connections, reclaim_max: reclaim_max},
+        _
+      ) do
+    Logger.debug(fn ->
+      "Connection pool is exhausted (reached #{max_connections} connections). Starting idle connection cleanup to reclaim as much as #{
+        reclaim_max
+      } connections"
+    end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :reclaim, :stop],
+        %{reclaimed_count: 0},
+        _,
+        _
+      ) do
+    Logger.error(fn ->
+      "Connection pool failed to reclaim any connections due to all of them being in use. It will have to drop requests for opening connections to new hosts"
+    end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :reclaim, :stop],
+        %{reclaimed_count: reclaimed_count},
+        _,
+        _
+      ) do
+    Logger.debug(fn -> "Connection pool cleaned up #{reclaimed_count} idle connections" end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :provision_failure],
+        %{opts: [key | _]},
+        _,
+        _
+      ) do
+    Logger.error(fn ->
+      "Connection pool had to refuse opening a connection to #{key} due to connection limit exhaustion"
+    end)
+  end
+
+  def handle_event(
+        [:pleroma, :connection_pool, :client_death],
+        %{client_pid: client_pid, reason: reason},
+        %{key: key},
+        _
+      ) do
+    Logger.warn(fn ->
+      "Pool worker for #{key}: Client #{inspect(client_pid)} died before releasing the connection with #{
+        inspect(reason)
+      }"
+    end)
+  end
+end

lib/pleroma/tesla/middleware/follow_redirects.ex

@@ -0,0 +1,110 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2015-2020 Tymon Tobolski <https://github.com/teamon/tesla/blob/master/lib/tesla/middleware/follow_redirects.ex>
+# Copyright © 2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.HTTP.Middleware.FollowRedirects do
+  @moduledoc """
+  Pool-aware version of https://github.com/teamon/tesla/blob/master/lib/tesla/middleware/follow_redirects.ex
+
+  Follow 3xx redirects
+  ## Options
+  - `:max_redirects` - limit number of redirects (default: `5`)
+  """
+
+  alias Pleroma.Gun.ConnectionPool
+
+  @behaviour Tesla.Middleware
+
+  @max_redirects 5
+  @redirect_statuses [301, 302, 303, 307, 308]
+
+  @impl Tesla.Middleware
+  def call(env, next, opts \\ []) do
+    max = Keyword.get(opts, :max_redirects, @max_redirects)
+
+    redirect(env, next, max)
+  end
+
+  defp redirect(env, next, left) do
+    opts = env.opts[:adapter]
+
+    case Tesla.run(env, next) do
+      {:ok, %{status: status} = res} when status in @redirect_statuses and left > 0 ->
+        release_conn(opts)
+
+        case Tesla.get_header(res, "location") do
+          nil ->
+            {:ok, res}
+
+          location ->
+            location = parse_location(location, res)
+
+            case get_conn(location, opts) do
+              {:ok, opts} ->
+                %{env | opts: Keyword.put(env.opts, :adapter, opts)}
+                |> new_request(res.status, location)
+                |> redirect(next, left - 1)
+
+              e ->
+                e
+            end
+        end
+
+      {:ok, %{status: status}} when status in @redirect_statuses ->
+        release_conn(opts)
+        {:error, {__MODULE__, :too_many_redirects}}
+
+      {:error, _} = e ->
+        release_conn(opts)
+        e
+
+      other ->
+        unless opts[:body_as] == :chunks do
+          release_conn(opts)
+        end
+
+        other
+    end
+  end
+
+  defp get_conn(location, opts) do
+    uri = URI.parse(location)
+
+    case ConnectionPool.get_conn(uri, opts) do
+      {:ok, conn} ->
+        {:ok, Keyword.merge(opts, conn: conn)}
+
+      e ->
+        e
+    end
+  end
+
+  defp release_conn(opts) do
+    ConnectionPool.release_conn(opts[:conn])
+  end
+
+  # The 303 (See Other) redirect was added in HTTP/1.1 to indicate that the originally
+  # requested resource is not available, however a related resource (or another redirect)
+  # available via GET is available at the specified location.
+  # https://tools.ietf.org/html/rfc7231#section-6.4.4
+  defp new_request(env, 303, location), do: %{env | url: location, method: :get, query: []}
+
+  # The 307 (Temporary Redirect) status code indicates that the target
+  # resource resides temporarily under a different URI and the user agent
+  # MUST NOT change the request method (...)
+  # https://tools.ietf.org/html/rfc7231#section-6.4.7
+  defp new_request(env, 307, location), do: %{env | url: location}
+
+  defp new_request(env, _, location), do: %{env | url: location, query: []}
+
+  defp parse_location("https://" <> _rest = location, _env), do: location
+  defp parse_location("http://" <> _rest = location, _env), do: location
+
+  defp parse_location(location, env) do
+    env.url
+    |> URI.parse()
+    |> URI.merge(location)
+    |> URI.to_string()
+  end
+end

lib/pleroma/upload.ex

@@ -63,6 +63,10 @@ defmodule Pleroma.Upload do
     with {:ok, upload} <- prepare_upload(upload, opts),
          upload = %__MODULE__{upload | path: upload.path || "#{upload.id}/#{upload.name}"},
          {:ok, upload} <- Pleroma.Upload.Filter.filter(opts.filters, upload),
+         description = Map.get(opts, :description) || upload.name,
+         {_, true} <-
+           {:description_limit,
+            String.length(description) <= Pleroma.Config.get([:instance, :description_limit])},
          {:ok, url_spec} <- Pleroma.Uploaders.Uploader.put_file(opts.uploader, upload) do
       {:ok,
        %{
@@ -75,9 +79,12 @@ defmodule Pleroma.Upload do
              "href" => url_from_spec(upload, opts.base_url, url_spec)
            }
          ],
-         "name" => Map.get(opts, :description) || upload.name
+         "name" => description
        }}
     else
+      {:description_limit, _} ->
+        {:error, :description_too_long}
+
       {:error, error} ->
         Logger.error(
           "#{__MODULE__} store (using #{inspect(opts.uploader)}) failed: #{inspect(error)}"

lib/pleroma/upload/filter/exiftool.ex

@@ -0,0 +1,18 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Upload.Filter.Exiftool do
+  @moduledoc """
+  Strips GPS related EXIF tags and overwrites the file in place.
+  Also strips or replaces filesystem metadata e.g., timestamps.
+  """
+  @behaviour Pleroma.Upload.Filter
+
+  def filter(%Pleroma.Upload{tempfile: file, content_type: "image" <> _}) do
+    System.cmd("exiftool", ["-overwrite_original", "-gps:all=", file], parallelism: true)
+    :ok
+  end
+
+  def filter(_), do: :ok
+end

lib/pleroma/user.ex

@@ -89,7 +89,7 @@ defmodule Pleroma.User do
     field(:keys, :string)
     field(:public_key, :string)
     field(:ap_id, :string)
-    field(:avatar, :map)
+    field(:avatar, :map, default: %{})
     field(:local, :boolean, default: true)
     field(:follower_address, :string)
     field(:following_address, :string)
@@ -115,7 +115,7 @@ defmodule Pleroma.User do
     field(:is_moderator, :boolean, default: false)
     field(:is_admin, :boolean, default: false)
     field(:show_role, :boolean, default: true)
-    field(:settings, :map, default: nil)
+    field(:mastofe_settings, :map, default: nil)
     field(:uri, ObjectValidators.Uri, default: nil)
     field(:hide_followers_count, :boolean, default: false)
     field(:hide_follows_count, :boolean, default: false)
@@ -138,6 +138,7 @@ defmodule Pleroma.User do
     field(:also_known_as, {:array, :string}, default: [])
     field(:inbox, :string)
     field(:shared_inbox, :string)
+    field(:accepts_chat_messages, :boolean, default: nil)
 
     embeds_one(
       :notification_settings,
@@ -388,8 +389,8 @@ defmodule Pleroma.User do
   defp fix_follower_address(params), do: params
 
   def remote_user_changeset(struct \\ %User{local: false}, params) do
-    bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000)
+    bio_limit = Config.get([:instance, :user_bio_length], 5000)
-    name_limit = Pleroma.Config.get([:instance, :user_name_length], 100)
+    name_limit = Config.get([:instance, :user_name_length], 100)
 
     name =
       case params[:name] do
@@ -436,7 +437,8 @@ defmodule Pleroma.User do
         :discoverable,
         :invisible,
         :actor_type,
-        :also_known_as
+        :also_known_as,
+        :accepts_chat_messages
       ]
     )
     |> validate_required([:name, :ap_id])
@@ -448,8 +450,8 @@ defmodule Pleroma.User do
   end
 
   def update_changeset(struct, params \\ %{}) do
-    bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000)
+    bio_limit = Config.get([:instance, :user_bio_length], 5000)
-    name_limit = Pleroma.Config.get([:instance, :user_name_length], 100)
+    name_limit = Config.get([:instance, :user_name_length], 100)
 
     struct
     |> cast(
@@ -481,7 +483,8 @@ defmodule Pleroma.User do
         :pleroma_settings_store,
         :discoverable,
         :actor_type,
-        :also_known_as
+        :also_known_as,
+        :accepts_chat_messages
       ]
     )
     |> unique_constraint(:nickname)
@@ -527,11 +530,21 @@ defmodule Pleroma.User do
   end
 
   defp put_emoji(changeset) do
-    bio = get_change(changeset, :bio)
+    emojified_fields = [:bio, :name, :raw_fields]
-    name = get_change(changeset, :name)
+
+    if Enum.any?(changeset.changes, fn {k, _} -> k in emojified_fields end) do
+      bio = Emoji.Formatter.get_emoji_map(get_field(changeset, :bio))
+      name = Emoji.Formatter.get_emoji_map(get_field(changeset, :name))
+
+      emoji = Map.merge(bio, name)
+
+      emoji =
+        changeset
+        |> get_field(:raw_fields)
+        |> Enum.reduce(emoji, fn x, acc ->
+          Map.merge(acc, Emoji.Formatter.get_emoji_map(x["name"] <> x["value"]))
+        end)
 
-    if bio || name do
-      emoji = Map.merge(Emoji.Formatter.get_emoji_map(bio), Emoji.Formatter.get_emoji_map(name))
       put_change(changeset, :emoji, emoji)
     else
       changeset
@@ -539,15 +552,12 @@ defmodule Pleroma.User do
   end
 
   defp put_change_if_present(changeset, map_field, value_function) do
-    if value = get_change(changeset, map_field) do
+    with {:ok, value} <- fetch_change(changeset, map_field),
-      with {:ok, new_value} <- value_function.(value) do
+         {:ok, new_value} <- value_function.(value) do
       put_change(changeset, map_field, new_value)
     else
       _ -> changeset
     end
-    else
-      changeset
-    end
   end
 
   defp put_upload(value, type) do
@@ -621,12 +631,13 @@ defmodule Pleroma.User do
   def force_password_reset(user), do: update_password_reset_pending(user, true)
 
   def register_changeset(struct, params \\ %{}, opts \\ []) do
-    bio_limit = Pleroma.Config.get([:instance, :user_bio_length], 5000)
+    bio_limit = Config.get([:instance, :user_bio_length], 5000)
-    name_limit = Pleroma.Config.get([:instance, :user_name_length], 100)
+    name_limit = Config.get([:instance, :user_name_length], 100)
+    params = Map.put_new(params, :accepts_chat_messages, true)
 
     need_confirmation? =
       if is_nil(opts[:need_confirmation]) do
-        Pleroma.Config.get([:instance, :account_activation_required])
+        Config.get([:instance, :account_activation_required])
       else
         opts[:need_confirmation]
       end
@@ -641,13 +652,14 @@ defmodule Pleroma.User do
       :nickname,
       :password,
       :password_confirmation,
-      :emoji
+      :emoji,
+      :accepts_chat_messages
     ])
     |> validate_required([:name, :nickname, :password, :password_confirmation])
     |> validate_confirmation(:password)
     |> unique_constraint(:email)
     |> unique_constraint(:nickname)
-    |> validate_exclusion(:nickname, Pleroma.Config.get([User, :restricted_nicknames]))
+    |> validate_exclusion(:nickname, Config.get([User, :restricted_nicknames]))
     |> validate_format(:nickname, local_nickname_regex())
     |> validate_format(:email, @email_regex)
     |> validate_length(:bio, max: bio_limit)
@@ -662,7 +674,7 @@ defmodule Pleroma.User do
   def maybe_validate_required_email(changeset, true), do: changeset
 
   def maybe_validate_required_email(changeset, _) do
-    if Pleroma.Config.get([:instance, :account_activation_required]) do
+    if Config.get([:instance, :account_activation_required]) do
       validate_required(changeset, [:email])
     else
       changeset
@@ -682,7 +694,7 @@ defmodule Pleroma.User do
   end
 
   defp autofollow_users(user) do
-    candidates = Pleroma.Config.get([:instance, :autofollowed_nicknames])
+    candidates = Config.get([:instance, :autofollowed_nicknames])
 
     autofollowed_users =
       User.Query.build(%{nickname: candidates, local: true, deactivated: false})
@@ -709,7 +721,7 @@ defmodule Pleroma.User do
 
   def try_send_confirmation_email(%User{} = user) do
     if user.confirmation_pending &&
-         Pleroma.Config.get([:instance, :account_activation_required]) do
+         Config.get([:instance, :account_activation_required]) do
       user
       |> Pleroma.Emails.UserEmail.account_confirmation_email()
       |> Pleroma.Emails.Mailer.deliver_async()
@@ -766,7 +778,7 @@ defmodule Pleroma.User do
   defdelegate following(user), to: FollowingRelationship
 
   def follow(%User{} = follower, %User{} = followed, state \\ :follow_accept) do
-    deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked])
+    deny_follow_blocked = Config.get([:user, :deny_follow_blocked])
 
     cond do
       followed.deactivated ->
@@ -967,7 +979,7 @@ defmodule Pleroma.User do
   end
 
   def get_cached_by_nickname_or_id(nickname_or_id, opts \\ []) do
-    restrict_to_local = Pleroma.Config.get([:instance, :limit_to_local_content])
+    restrict_to_local = Config.get([:instance, :limit_to_local_content])
 
     cond do
       is_integer(nickname_or_id) or FlakeId.flake_id?(nickname_or_id) ->
@@ -1163,7 +1175,7 @@ defmodule Pleroma.User do
 
   @spec update_follower_count(User.t()) :: {:ok, User.t()}
   def update_follower_count(%User{} = user) do
-    if user.local or !Pleroma.Config.get([:instance, :external_user_synchronization]) do
+    if user.local or !Config.get([:instance, :external_user_synchronization]) do
       follower_count = FollowingRelationship.follower_count(user)
 
       user
@@ -1176,7 +1188,7 @@ defmodule Pleroma.User do
 
   @spec update_following_count(User.t()) :: {:ok, User.t()}
   def update_following_count(%User{local: false} = user) do
-    if Pleroma.Config.get([:instance, :external_user_synchronization]) do
+    if Config.get([:instance, :external_user_synchronization]) do
       {:ok, maybe_fetch_follow_information(user)}
     else
       {:ok, user}
@@ -1263,7 +1275,7 @@ defmodule Pleroma.User do
   end
 
   def subscribe(%User{} = subscriber, %User{} = target) do
-    deny_follow_blocked = Pleroma.Config.get([:user, :deny_follow_blocked])
+    deny_follow_blocked = Config.get([:user, :deny_follow_blocked])
 
     if blocks?(target, subscriber) and deny_follow_blocked do
       {:error, "Could not subscribe: #{target.nickname} is blocking you"}
@@ -1309,7 +1321,8 @@ defmodule Pleroma.User do
 
     unsubscribe(blocked, blocker)
 
-    if following?(blocked, blocker), do: unfollow(blocked, blocker)
+    unfollowing_blocked = Config.get([:activitypub, :unfollow_blocked], true)
+    if unfollowing_blocked && following?(blocked, blocker), do: unfollow(blocked, blocker)
 
     {:ok, blocker} = update_follower_count(blocker)
     {:ok, blocker, _} = Participation.mark_all_as_read(blocker, blocked)
@@ -1527,8 +1540,7 @@ defmodule Pleroma.User do
       blocked_identifiers,
       fn blocked_identifier ->
         with {:ok, %User{} = blocked} <- get_or_fetch(blocked_identifier),
-             {:ok, _user_block} <- block(blocker, blocked),
+             {:ok, _block} <- CommonAPI.block(blocker, blocked) do
-             {:ok, _} <- ActivityPub.block(blocker, blocked) do
           blocked
         else
           err ->
@@ -1546,7 +1558,7 @@ defmodule Pleroma.User do
       fn followed_identifier ->
         with {:ok, %User{} = followed} <- get_or_fetch(followed_identifier),
              {:ok, follower} <- maybe_direct_follow(follower, followed),
-             {:ok, _} <- ActivityPub.follow(follower, followed) do
+             {:ok, _, _, _} <- CommonAPI.follow(follower, followed) do
           followed
         else
           err ->
@@ -1654,7 +1666,7 @@ defmodule Pleroma.User do
     Pleroma.HTML.Scrubber.TwitterText
   end
 
-  def html_filter_policy(_), do: Pleroma.Config.get([:markup, :scrub_policy])
+  def html_filter_policy(_), do: Config.get([:markup, :scrub_policy])
 
   def fetch_by_ap_id(ap_id), do: ActivityPub.make_user_from_ap_id(ap_id)
 
@@ -1836,7 +1848,7 @@ defmodule Pleroma.User do
   end
 
   defp local_nickname_regex do
-    if Pleroma.Config.get([:instance, :extended_nickname_format]) do
+    if Config.get([:instance, :extended_nickname_format]) do
       @extended_local_nickname_regex
     else
       @strict_local_nickname_regex
@@ -1964,8 +1976,8 @@ defmodule Pleroma.User do
 
   def get_mascot(%{mascot: mascot}) when is_nil(mascot) do
     # use instance-default
-    config = Pleroma.Config.get([:assets, :mascots])
+    config = Config.get([:assets, :mascots])
-    default_mascot = Pleroma.Config.get([:assets, :default_mascot])
+    default_mascot = Config.get([:assets, :default_mascot])
     mascot = Keyword.get(config, default_mascot)
 
     %{
@@ -2060,7 +2072,7 @@ defmodule Pleroma.User do
 
   def validate_fields(changeset, remote? \\ false) do
     limit_name = if remote?, do: :max_remote_account_fields, else: :max_account_fields
-    limit = Pleroma.Config.get([:instance, limit_name], 0)
+    limit = Config.get([:instance, limit_name], 0)
 
     changeset
     |> validate_length(:fields, max: limit)
@@ -2074,8 +2086,8 @@ defmodule Pleroma.User do
   end
 
   defp valid_field?(%{"name" => name, "value" => value}) do
-    name_limit = Pleroma.Config.get([:instance, :account_field_name_length], 255)
+    name_limit = Config.get([:instance, :account_field_name_length], 255)
-    value_limit = Pleroma.Config.get([:instance, :account_field_value_length], 255)
+    value_limit = Config.get([:instance, :account_field_value_length], 255)
 
     is_binary(name) && is_binary(value) && String.length(name) <= name_limit &&
       String.length(value) <= value_limit
@@ -2085,10 +2097,10 @@ defmodule Pleroma.User do
 
   defp truncate_field(%{"name" => name, "value" => value}) do
     {name, _chopped} =
-      String.split_at(name, Pleroma.Config.get([:instance, :account_field_name_length], 255))
+      String.split_at(name, Config.get([:instance, :account_field_name_length], 255))
 
     {value, _chopped} =
-      String.split_at(value, Pleroma.Config.get([:instance, :account_field_value_length], 255))
+      String.split_at(value, Config.get([:instance, :account_field_value_length], 255))
 
     %{"name" => name, "value" => value}
   end
@@ -2118,8 +2130,8 @@ defmodule Pleroma.User do
 
   def mastodon_settings_update(user, settings) do
     user
-    |> cast(%{settings: settings}, [:settings])
+    |> cast(%{mastofe_settings: settings}, [:mastofe_settings])
-    |> validate_required([:settings])
+    |> validate_required([:mastofe_settings])
     |> update_and_set_cache()
   end
 
@@ -2143,7 +2155,7 @@ defmodule Pleroma.User do
 
   def add_pinnned_activity(user, %Pleroma.Activity{id: id}) do
     if id not in user.pinned_activities do
-      max_pinned_statuses = Pleroma.Config.get([:instance, :max_pinned_statuses], 0)
+      max_pinned_statuses = Config.get([:instance, :max_pinned_statuses], 0)
       params = %{pinned_activities: user.pinned_activities ++ [id]}
 
       user

lib/pleroma/user/notification_setting.ex

@@ -10,21 +10,15 @@ defmodule Pleroma.User.NotificationSetting do
   @primary_key false
 
   embedded_schema do
-    field(:followers, :boolean, default: true)
+    field(:block_from_strangers, :boolean, default: false)
-    field(:follows, :boolean, default: true)
+    field(:hide_notification_contents, :boolean, default: false)
-    field(:non_follows, :boolean, default: true)
-    field(:non_followers, :boolean, default: true)
-    field(:privacy_option, :boolean, default: false)
   end
 
   def changeset(schema, params) do
     schema
     |> cast(prepare_attrs(params), [
-      :followers,
+      :block_from_strangers,
-      :follows,
+      :hide_notification_contents
-      :non_follows,
-      :non_followers,
-      :privacy_option
     ])
   end
 

lib/pleroma/user/search.ex

@@ -52,6 +52,7 @@ defmodule Pleroma.User.Search do
     |> base_query(following)
     |> filter_blocked_user(for_user)
     |> filter_invisible_users()
+    |> filter_internal_users()
     |> filter_blocked_domains(for_user)
     |> fts_search(query_string)
     |> trigram_rank(query_string)
@@ -68,11 +69,15 @@ defmodule Pleroma.User.Search do
       u in query,
       where:
         fragment(
+          # The fragment must _exactly_ match `users_fts_index`, otherwise the index won't work
           """
-          (to_tsvector('simple', ?) || to_tsvector('simple', ?)) @@ to_tsquery('simple', ?)
+          (
+            setweight(to_tsvector('simple', regexp_replace(?, '\\W', ' ', 'g')), 'A') ||
+            setweight(to_tsvector('simple', regexp_replace(coalesce(?, ''), '\\W', ' ', 'g')), 'B')
+          ) @@ to_tsquery('simple', ?)
           """,
-          u.name,
           u.nickname,
+          u.name,
           ^query_string
         )
     )
@@ -87,15 +92,23 @@ defmodule Pleroma.User.Search do
     |> Enum.join(" | ")
   end
 
+  # Considers nickname match, localized nickname match, name match; preferences nickname match
   defp trigram_rank(query, query_string) do
     from(
       u in query,
       select_merge: %{
         search_rank:
           fragment(
-            "similarity(?, trim(? || ' ' || coalesce(?, '')))",
+            """
+            similarity(?, ?) +
+            similarity(?, regexp_replace(?, '@.+', '')) +
+            similarity(?, trim(coalesce(?, '')))
+            """,
             ^query_string,
             u.nickname,
+            ^query_string,
+            u.nickname,
+            ^query_string,
             u.name
           )
       }
@@ -109,6 +122,10 @@ defmodule Pleroma.User.Search do
     from(q in query, where: q.invisible == false)
   end
 
+  defp filter_internal_users(query) do
+    from(q in query, where: q.actor_type != "Application")
+  end
+
   defp filter_blocked_user(query, %User{} = blocker) do
     query
     |> join(:left, [u], b in Pleroma.UserRelationship,

lib/pleroma/web/activity_pub/activity_pub.ex

@@ -10,6 +10,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
   alias Pleroma.Constants
   alias Pleroma.Conversation
   alias Pleroma.Conversation.Participation
+  alias Pleroma.Filter
   alias Pleroma.Maps
   alias Pleroma.Notification
   alias Pleroma.Object
@@ -321,28 +322,6 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
     end
   end
 
-  @spec follow(User.t(), User.t(), String.t() | nil, boolean(), keyword()) ::
-          {:ok, Activity.t()} | {:error, any()}
-  def follow(follower, followed, activity_id \\ nil, local \\ true, opts \\ []) do
-    with {:ok, result} <-
-           Repo.transaction(fn -> do_follow(follower, followed, activity_id, local, opts) end) do
-      result
-    end
-  end
-
-  defp do_follow(follower, followed, activity_id, local, opts) do
-    skip_notify_and_stream = Keyword.get(opts, :skip_notify_and_stream, false)
-    data = make_follow_data(follower, followed, activity_id)
-
-    with {:ok, activity} <- insert(data, local),
-         _ <- skip_notify_and_stream || notify_and_stream(activity),
-         :ok <- maybe_federate(activity) do
-      {:ok, activity}
-    else
-      {:error, error} -> Repo.rollback(error)
-    end
-  end
-
   @spec unfollow(User.t(), User.t(), String.t() | nil, boolean()) ::
           {:ok, Activity.t()} | nil | {:error, any()}
   def unfollow(follower, followed, activity_id \\ nil, local \\ true) do
@@ -366,33 +345,6 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
     end
   end
 
-  @spec block(User.t(), User.t(), String.t() | nil, boolean()) ::
-          {:ok, Activity.t()} | {:error, any()}
-  def block(blocker, blocked, activity_id \\ nil, local \\ true) do
-    with {:ok, result} <-
-           Repo.transaction(fn -> do_block(blocker, blocked, activity_id, local) end) do
-      result
-    end
-  end
-
-  defp do_block(blocker, blocked, activity_id, local) do
-    unfollow_blocked = Config.get([:activitypub, :unfollow_blocked])
-
-    if unfollow_blocked and fetch_latest_follow(blocker, blocked) do
-      unfollow(blocker, blocked, nil, local)
-    end
-
-    block_data = make_block_data(blocker, blocked, activity_id)
-
-    with {:ok, activity} <- insert(block_data, local),
-         _ <- notify_and_stream(activity),
-         :ok <- maybe_federate(activity) do
-      {:ok, activity}
-    else
-      {:error, error} -> Repo.rollback(error)
-    end
-  end
-
   @spec flag(map()) :: {:ok, Activity.t()} | {:error, any()}
   def flag(
         %{
@@ -473,6 +425,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
     |> maybe_set_thread_muted_field(opts)
     |> restrict_blocked(opts)
     |> restrict_recipients(recipients, opts[:user])
+    |> restrict_filtered(opts)
     |> where(
       [activity],
       fragment(
@@ -988,6 +941,26 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
 
   defp restrict_instance(query, _), do: query
 
+  defp restrict_filtered(query, %{user: %User{} = user}) do
+    case Filter.compose_regex(user) do
+      nil ->
+        query
+
+      regex ->
+        from([activity, object] in query,
+          where:
+            fragment("not(?->>'content' ~* ?)", object.data, ^regex) or
+              activity.actor == ^user.ap_id
+        )
+    end
+  end
+
+  defp restrict_filtered(query, %{blocking_user: %User{} = user}) do
+    restrict_filtered(query, %{user: user})
+  end
+
+  defp restrict_filtered(query, _), do: query
+
   defp exclude_poll_votes(query, %{include_poll_votes: true}), do: query
 
   defp exclude_poll_votes(query, _) do
@@ -1118,6 +1091,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
     |> restrict_favorited_by(opts)
     |> restrict_blocked(restrict_blocked_opts)
     |> restrict_muted(restrict_muted_opts)
+    |> restrict_filtered(opts)
     |> restrict_media(opts)
     |> restrict_visibility(opts)
     |> restrict_thread_visibility(opts, config)
@@ -1126,6 +1100,7 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
     |> restrict_muted_reblogs(restrict_muted_reblogs_opts)
     |> restrict_instance(opts)
     |> restrict_announce_object_actor(opts)
+    |> restrict_filtered(opts)
     |> Activity.restrict_deactivated_users()
     |> exclude_poll_votes(opts)
     |> exclude_chat_messages(opts)
@@ -1251,6 +1226,8 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
       end)
 
     locked = data["manuallyApprovesFollowers"] || false
+    capabilities = data["capabilities"] || %{}
+    accepts_chat_messages = capabilities["acceptsChatMessages"]
     data = Transmogrifier.maybe_fix_user_object(data)
     discoverable = data["discoverable"] || false
     invisible = data["invisible"] || false
@@ -1289,7 +1266,8 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
       also_known_as: Map.get(data, "alsoKnownAs", []),
       public_key: public_key,
       inbox: data["inbox"],
-      shared_inbox: shared_inbox
+      shared_inbox: shared_inbox,
+      accepts_chat_messages: accepts_chat_messages
     }
 
     # nickname can be nil because of virtual actors
@@ -1398,6 +1376,31 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
     end
   end
 
+  def maybe_handle_clashing_nickname(data) do
+    nickname = data[:nickname]
+
+    with %User{} = old_user <- User.get_by_nickname(nickname),
+         {_, false} <- {:ap_id_comparison, data[:ap_id] == old_user.ap_id} do
+      Logger.info(
+        "Found an old user for #{nickname}, the old ap id is #{old_user.ap_id}, new one is #{
+          data[:ap_id]
+        }, renaming."
+      )
+
+      old_user
+      |> User.remote_user_changeset(%{nickname: "#{old_user.id}.#{old_user.nickname}"})
+      |> User.update_and_set_cache()
+    else
+      {:ap_id_comparison, true} ->
+        Logger.info(
+          "Found an old user for #{nickname}, but the ap id #{data[:ap_id]} is the same as the new user. Race condition? Not changing anything."
+        )
+
+      _ ->
+        nil
+    end
+  end
+
   def make_user_from_ap_id(ap_id) do
     user = User.get_cached_by_ap_id(ap_id)
 
@@ -1410,6 +1413,8 @@ defmodule Pleroma.Web.ActivityPub.ActivityPub do
           |> User.remote_user_changeset(data)
           |> User.update_and_set_cache()
         else
+          maybe_handle_clashing_nickname(data)
+
           data
           |> User.remote_user_changeset()
           |> Repo.insert()

lib/pleroma/web/activity_pub/builder.ex

@@ -14,6 +14,19 @@ defmodule Pleroma.Web.ActivityPub.Builder do
 
   require Pleroma.Constants
 
+  @spec follow(User.t(), User.t()) :: {:ok, map(), keyword()}
+  def follow(follower, followed) do
+    data = %{
+      "id" => Utils.generate_activity_id(),
+      "actor" => follower.ap_id,
+      "type" => "Follow",
+      "object" => followed.ap_id,
+      "to" => [followed.ap_id]
+    }
+
+    {:ok, data, []}
+  end
+
   @spec emoji_react(User.t(), Object.t(), String.t()) :: {:ok, map(), keyword()}
   def emoji_react(actor, object, emoji) do
     with {:ok, data, meta} <- object_action(actor, object) do
@@ -138,6 +151,18 @@ defmodule Pleroma.Web.ActivityPub.Builder do
      }, []}
   end
 
+  @spec block(User.t(), User.t()) :: {:ok, map(), keyword()}
+  def block(blocker, blocked) do
+    {:ok,
+     %{
+       "id" => Utils.generate_activity_id(),
+       "type" => "Block",
+       "actor" => blocker.ap_id,
+       "object" => blocked.ap_id,
+       "to" => [blocked.ap_id]
+     }, []}
+  end
+
   @spec announce(User.t(), Object.t(), keyword()) :: {:ok, map(), keyword()}
   def announce(actor, object, options \\ []) do
     public? = Keyword.get(options, :public, false)

lib/pleroma/web/activity_pub/mrf/anti_followbot_policy.ex

@@ -60,7 +60,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.AntiFollowbotPolicy do
     if score < 0.8 do
       {:ok, message}
     else
-      {:reject, nil}
+      {:reject, "[AntiFollowbotPolicy] Scored #{actor_id} as #{score}"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/anti_link_spam_policy.ex

@@ -27,23 +27,25 @@ defmodule Pleroma.Web.ActivityPub.MRF.AntiLinkSpamPolicy do
 
   @impl true
   def filter(%{"type" => "Create", "actor" => actor, "object" => object} = message) do
-    with {:ok, %User{} = u} <- User.get_or_fetch_by_ap_id(actor),
+    with {:ok, %User{local: false} = u} <- User.get_or_fetch_by_ap_id(actor),
          {:contains_links, true} <- {:contains_links, contains_links?(object)},
          {:old_user, true} <- {:old_user, old_user?(u)} do
       {:ok, message}
     else
+      {:ok, %User{local: true}} ->
+        {:ok, message}
+
       {:contains_links, false} ->
         {:ok, message}
 
       {:old_user, false} ->
-        {:reject, nil}
+        {:reject, "[AntiLinkSpamPolicy] User has no posts nor followers"}
 
       {:error, _} ->
-        {:reject, nil}
+        {:reject, "[AntiLinkSpamPolicy] Failed to get or fetch user by ap_id"}
 
       e ->
-        Logger.warn("[MRF anti-link-spam] WTF: unhandled error #{inspect(e)}")
+        {:reject, "[AntiLinkSpamPolicy] Unhandled error #{inspect(e)}"}
-        {:reject, nil}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/hellthread_policy.ex

@@ -43,7 +43,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicy do
   defp reject_message(message, threshold) when threshold > 0 do
     with {_, recipients} <- get_recipient_count(message) do
       if recipients > threshold do
-        {:reject, nil}
+        {:reject, "[HellthreadPolicy] #{recipients} recipients is over the limit of #{threshold}"}
       else
         {:ok, message}
       end
@@ -87,7 +87,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.HellthreadPolicy do
          {:ok, message} <- delist_message(message, delist_threshold) do
       {:ok, message}
     else
-      _e -> {:reject, nil}
+      e -> e
     end
   end
 

lib/pleroma/web/activity_pub/mrf/keyword_policy.ex

@@ -24,7 +24,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.KeywordPolicy do
     if Enum.any?(Pleroma.Config.get([:mrf_keyword, :reject]), fn pattern ->
          string_matches?(content, pattern) or string_matches?(summary, pattern)
        end) do
-      {:reject, nil}
+      {:reject, "[KeywordPolicy] Matches with rejected keyword"}
     else
       {:ok, message}
     end
@@ -89,8 +89,9 @@ defmodule Pleroma.Web.ActivityPub.MRF.KeywordPolicy do
          {:ok, message} <- check_replace(message) do
       {:ok, message}
     else
-      _e ->
+      {:reject, nil} -> {:reject, "[KeywordPolicy] "}
-        {:reject, nil}
+      {:reject, _} = e -> e
+      _e -> {:reject, "[KeywordPolicy] "}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/mention_policy.ex

@@ -12,8 +12,9 @@ defmodule Pleroma.Web.ActivityPub.MRF.MentionPolicy do
     reject_actors = Pleroma.Config.get([:mrf_mention, :actors], [])
     recipients = (message["to"] || []) ++ (message["cc"] || [])
 
-    if Enum.any?(recipients, fn recipient -> Enum.member?(reject_actors, recipient) end) do
+    if rejected_mention =
-      {:reject, nil}
+         Enum.find(recipients, fn recipient -> Enum.member?(reject_actors, recipient) end) do
+      {:reject, "[MentionPolicy] Rejected for mention of #{rejected_mention}"}
     else
       {:ok, message}
     end

lib/pleroma/web/activity_pub/mrf/object_age_policy.ex

@@ -28,7 +28,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy do
 
   defp check_reject(message, actions) do
     if :reject in actions do
-      {:reject, nil}
+      {:reject, "[ObjectAgePolicy]"}
     else
       {:ok, message}
     end
@@ -47,9 +47,8 @@ defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy do
 
         {:ok, message}
       else
-        # Unhandleable error: somebody is messing around, just drop the message.
         _e ->
-          {:reject, nil}
+          {:reject, "[ObjectAgePolicy] Unhandled error"}
       end
     else
       {:ok, message}
@@ -69,9 +68,8 @@ defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy do
 
         {:ok, message}
       else
-        # Unhandleable error: somebody is messing around, just drop the message.
         _e ->
-          {:reject, nil}
+          {:reject, "[ObjectAgePolicy] Unhandled error"}
       end
     else
       {:ok, message}
@@ -98,7 +96,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.ObjectAgePolicy do
   @impl true
   def describe do
     mrf_object_age =
-      Pleroma.Config.get(:mrf_object_age)
+      Config.get(:mrf_object_age)
       |> Enum.into(%{})
 
     {:ok, %{mrf_object_age: mrf_object_age}}

lib/pleroma/web/activity_pub/mrf/reject_non_public.ex

@@ -38,7 +38,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.RejectNonPublic do
         {:ok, object}
 
       true ->
-        {:reject, nil}
+        {:reject, "[RejectNonPublic] visibility: #{visibility}"}
     end
   end
 
@@ -47,5 +47,5 @@ defmodule Pleroma.Web.ActivityPub.MRF.RejectNonPublic do
 
   @impl true
   def describe,
-    do: {:ok, %{mrf_rejectnonpublic: Pleroma.Config.get(:mrf_rejectnonpublic) |> Enum.into(%{})}}
+    do: {:ok, %{mrf_rejectnonpublic: Config.get(:mrf_rejectnonpublic) |> Enum.into(%{})}}
 end

lib/pleroma/web/activity_pub/mrf/simple_policy.ex

@@ -21,7 +21,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
       accepts == [] -> {:ok, object}
       actor_host == Config.get([Pleroma.Web.Endpoint, :url, :host]) -> {:ok, object}
       MRF.subdomain_match?(accepts, actor_host) -> {:ok, object}
-      true -> {:reject, nil}
+      true -> {:reject, "[SimplePolicy] host not in accept list"}
     end
   end
 
@@ -31,7 +31,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
       |> MRF.subdomains_regex()
 
     if MRF.subdomain_match?(rejects, actor_host) do
-      {:reject, nil}
+      {:reject, "[SimplePolicy] host in reject list"}
     else
       {:ok, object}
     end
@@ -114,7 +114,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
       |> MRF.subdomains_regex()
 
     if MRF.subdomain_match?(report_removal, actor_host) do
-      {:reject, nil}
+      {:reject, "[SimplePolicy] host in report_removal list"}
     else
       {:ok, object}
     end
@@ -155,11 +155,11 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
     %{host: actor_host} = URI.parse(actor)
 
     reject_deletes =
-      Pleroma.Config.get([:mrf_simple, :reject_deletes])
+      Config.get([:mrf_simple, :reject_deletes])
       |> MRF.subdomains_regex()
 
     if MRF.subdomain_match?(reject_deletes, actor_host) do
-      {:reject, nil}
+      {:reject, "[SimplePolicy] host in reject_deletes list"}
     else
       {:ok, object}
     end
@@ -177,7 +177,9 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
          {:ok, object} <- check_report_removal(actor_info, object) do
       {:ok, object}
     else
-      _e -> {:reject, nil}
+      {:reject, nil} -> {:reject, "[SimplePolicy]"}
+      {:reject, _} = e -> e
+      _ -> {:reject, "[SimplePolicy]"}
     end
   end
 
@@ -191,7 +193,9 @@ defmodule Pleroma.Web.ActivityPub.MRF.SimplePolicy do
          {:ok, object} <- check_banner_removal(actor_info, object) do
       {:ok, object}
     else
-      _e -> {:reject, nil}
+      {:reject, nil} -> {:reject, "[SimplePolicy]"}
+      {:reject, _} = e -> e
+      _ -> {:reject, "[SimplePolicy]"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/tag_policy.ex

@@ -134,12 +134,13 @@ defmodule Pleroma.Web.ActivityPub.MRF.TagPolicy do
     if user.local == true do
       {:ok, message}
     else
-      {:reject, nil}
+      {:reject,
+       "[TagPolicy] Follow from #{actor} tagged with mrf_tag:disable-remote-subscription"}
     end
   end
 
-  defp process_tag("mrf_tag:disable-any-subscription", %{"type" => "Follow"}),
+  defp process_tag("mrf_tag:disable-any-subscription", %{"type" => "Follow", "actor" => actor}),
-    do: {:reject, nil}
+    do: {:reject, "[TagPolicy] Follow from #{actor} tagged with mrf_tag:disable-any-subscription"}
 
   defp process_tag(_, message), do: {:ok, message}
 

lib/pleroma/web/activity_pub/mrf/user_allow_list_policy.ex

@@ -14,7 +14,7 @@ defmodule Pleroma.Web.ActivityPub.MRF.UserAllowListPolicy do
     if actor in allow_list do
       {:ok, object}
     else
-      {:reject, nil}
+      {:reject, "[UserAllowListPolicy] #{actor} not in the list"}
     end
   end
 

lib/pleroma/web/activity_pub/mrf/vocabulary_policy.ex

@@ -11,22 +11,26 @@ defmodule Pleroma.Web.ActivityPub.MRF.VocabularyPolicy do
     with {:ok, _} <- filter(child_message) do
       {:ok, message}
     else
-      {:reject, nil} ->
+      {:reject, _} = e -> e
-        {:reject, nil}
     end
   end
 
   def filter(%{"type" => message_type} = message) do
     with accepted_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :accept]),
          rejected_vocabulary <- Pleroma.Config.get([:mrf_vocabulary, :reject]),
-         true <-
+         {_, true} <-
-           Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type),
+           {:accepted,
-         false <-
+            Enum.empty?(accepted_vocabulary) || Enum.member?(accepted_vocabulary, message_type)},
-           length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type),
+         {_, false} <-
+           {:rejected,
+            length(rejected_vocabulary) > 0 && Enum.member?(rejected_vocabulary, message_type)},
          {:ok, _} <- filter(message["object"]) do
       {:ok, message}
     else
-      _ -> {:reject, nil}
+      {:reject, _} = e -> e
+      {:accepted, _} -> {:reject, "[VocabularyPolicy] #{message_type} not in accept list"}
+      {:rejected, _} -> {:reject, "[VocabularyPolicy] #{message_type} in reject list"}
+      _ -> {:reject, "[VocabularyPolicy]"}
     end
   end
 

lib/pleroma/web/activity_pub/object_validator.ex

@@ -13,10 +13,12 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidator do
   alias Pleroma.Object
   alias Pleroma.User
   alias Pleroma.Web.ActivityPub.ObjectValidators.AnnounceValidator
+  alias Pleroma.Web.ActivityPub.ObjectValidators.BlockValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.ChatMessageValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.CreateChatMessageValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.DeleteValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.EmojiReactValidator
+  alias Pleroma.Web.ActivityPub.ObjectValidators.FollowValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.LikeValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.UndoValidator
   alias Pleroma.Web.ActivityPub.ObjectValidators.UpdateValidator
@@ -24,6 +26,35 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidator do
   @spec validate(map(), keyword()) :: {:ok, map(), keyword()} | {:error, any()}
   def validate(object, meta)
 
+  def validate(%{"type" => "Follow"} = object, meta) do
+    with {:ok, object} <-
+           object
+           |> FollowValidator.cast_and_validate()
+           |> Ecto.Changeset.apply_action(:insert) do
+      object = stringify_keys(object)
+      {:ok, object, meta}
+    end
+  end
+
+  def validate(%{"type" => "Block"} = block_activity, meta) do
+    with {:ok, block_activity} <-
+           block_activity
+           |> BlockValidator.cast_and_validate()
+           |> Ecto.Changeset.apply_action(:insert) do
+      block_activity = stringify_keys(block_activity)
+      outgoing_blocks = Pleroma.Config.get([:activitypub, :outgoing_blocks])
+
+      meta =
+        if !outgoing_blocks do
+          Keyword.put(meta, :do_not_federate, true)
+        else
+          meta
+        end
+
+      {:ok, block_activity, meta}
+    end
+  end
+
   def validate(%{"type" => "Update"} = update_activity, meta) do
     with {:ok, update_activity} <-
            update_activity

lib/pleroma/web/activity_pub/object_validators/block_validator.ex

@@ -0,0 +1,42 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.BlockValidator do
+  use Ecto.Schema
+
+  alias Pleroma.EctoType.ActivityPub.ObjectValidators
+
+  import Ecto.Changeset
+  import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations
+
+  @primary_key false
+
+  embedded_schema do
+    field(:id, ObjectValidators.ObjectID, primary_key: true)
+    field(:type, :string)
+    field(:actor, ObjectValidators.ObjectID)
+    field(:to, ObjectValidators.Recipients, default: [])
+    field(:cc, ObjectValidators.Recipients, default: [])
+    field(:object, ObjectValidators.ObjectID)
+  end
+
+  def cast_data(data) do
+    %__MODULE__{}
+    |> cast(data, __schema__(:fields))
+  end
+
+  def validate_data(cng) do
+    cng
+    |> validate_required([:id, :type, :actor, :to, :cc, :object])
+    |> validate_inclusion(:type, ["Block"])
+    |> validate_actor_presence()
+    |> validate_actor_presence(field_name: :object)
+  end
+
+  def cast_and_validate(data) do
+    data
+    |> cast_data
+    |> validate_data
+  end
+end

lib/pleroma/web/activity_pub/object_validators/chat_message_validator.ex

@@ -93,12 +93,14 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.ChatMessageValidator do
   - If both users are in our system
   - If at least one of the users in this ChatMessage is a local user
   - If the recipient is not blocking the actor
+  - If the recipient is explicitly not accepting chat messages
   """
   def validate_local_concern(cng) do
     with actor_ap <- get_field(cng, :actor),
          {_, %User{} = actor} <- {:find_actor, User.get_cached_by_ap_id(actor_ap)},
          {_, %User{} = recipient} <-
            {:find_recipient, User.get_cached_by_ap_id(get_field(cng, :to) |> hd())},
+         {_, false} <- {:not_accepting_chats?, recipient.accepts_chat_messages == false},
          {_, false} <- {:blocking_actor?, User.blocks?(recipient, actor)},
          {_, true} <- {:local?, Enum.any?([actor, recipient], & &1.local)} do
       cng
@@ -107,6 +109,10 @@ defmodule Pleroma.Web.ActivityPub.ObjectValidators.ChatMessageValidator do
         cng
         |> add_error(:actor, "actor is blocked by recipient")
 
+      {:not_accepting_chats?, true} ->
+        cng
+        |> add_error(:to, "recipient does not accept chat messages")
+
       {:local?, false} ->
         cng
         |> add_error(:actor, "actor and recipient are both remote")

lib/pleroma/web/activity_pub/object_validators/follow_validator.ex

@@ -0,0 +1,44 @@
+# Pleroma: A lightweight social networking server
+# Copyright © 2017-2020 Pleroma Authors <https://pleroma.social/>
+# SPDX-License-Identifier: AGPL-3.0-only
+
+defmodule Pleroma.Web.ActivityPub.ObjectValidators.FollowValidator do
+  use Ecto.Schema
+
+  alias Pleroma.EctoType.ActivityPub.ObjectValidators
+
+  import Ecto.Changeset
+  import Pleroma.Web.ActivityPub.ObjectValidators.CommonValidations
+
+  @primary_key false
+
+  embedded_schema do
+    field(:id, ObjectValidators.ObjectID, primary_key: true)
+    field(:type, :string)
+    field(:actor, ObjectValidators.ObjectID)
+    field(:to, ObjectValidators.Recipients, default: [])
+    field(:cc, ObjectValidators.Recipients, default: [])
+    field(:object, ObjectValidators.ObjectID)
+    field(:state, :string, default: "pending")
+  end
+
+  def cast_data(data) do
+    %__MODULE__{}
+    |> cast(data, __schema__(:fields))
+  end
+
+  def validate_data(cng) do
+    cng
+    |> validate_required([:id, :type, :actor, :to, :cc, :object])
+    |> validate_inclusion(:type, ["Follow"])
+    |> validate_inclusion(:state, ~w{pending reject accept})
+    |> validate_actor_presence()
+    |> validate_actor_presence(field_name: :object)
+  end
+
+  def cast_and_validate(data) do
+    data
+    |> cast_data
+    |> validate_data
+  end
+end

lib/pleroma/web/activity_pub/publisher.ex

@@ -49,7 +49,8 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
   """
   def publish_one(%{inbox: inbox, json: json, actor: %User{} = actor, id: id} = params) do
     Logger.debug("Federating #{id} to #{inbox}")
-    %{host: host, path: path} = URI.parse(inbox)
+
+    uri = URI.parse(inbox)
 
     digest = "SHA-256=" <> (:crypto.hash(:sha256, json) |> Base.encode64())
 
@@ -57,8 +58,8 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
 
     signature =
       Pleroma.Signature.sign(actor, %{
-        "(request-target)": "post #{path}",
+        "(request-target)": "post #{uri.path}",
-        host: host,
+        host: signature_host(uri),
         "content-length": byte_size(json),
         digest: digest,
         date: date
@@ -76,8 +77,9 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
                  {"digest", digest}
                ]
              ) do
-      if !Map.has_key?(params, :unreachable_since) || params[:unreachable_since],
+      if not Map.has_key?(params, :unreachable_since) || params[:unreachable_since] do
-        do: Instances.set_reachable(inbox)
+        Instances.set_reachable(inbox)
+      end
 
       result
     else
@@ -96,6 +98,14 @@ defmodule Pleroma.Web.ActivityPub.Publisher do
     |> publish_one()
   end
 
+  defp signature_host(%URI{port: port, scheme: scheme, host: host}) do
+    if port == URI.default_port(scheme) do
+      host
+    else
+      "#{host}:#{port}"
+    end
+  end
+
   defp should_federate?(inbox, public) do
     if public do
       true

lib/pleroma/web/activity_pub/relay.ex

@@ -28,7 +28,7 @@ defmodule Pleroma.Web.ActivityPub.Relay do
   def follow(target_instance) do
     with %User{} = local_user <- get_actor(),
          {:ok, %User{} = target_user} <- User.get_or_fetch_by_ap_id(target_instance),
-         {:ok, activity} <- ActivityPub.follow(local_user, target_user) do
+         {:ok, _, _, activity} <- CommonAPI.follow(local_user, target_user) do
       Logger.info("relay: followed instance: #{target_instance}; id=#{activity.data["id"]}")
       {:ok, activity}
     else

lib/pleroma/web/activity_pub/side_effects.ex

@@ -6,8 +6,10 @@ defmodule Pleroma.Web.ActivityPub.SideEffects do
   collection, and so on.
   """
   alias Pleroma.Activity
+  alias Pleroma.Activity.Ir.Topics
   alias Pleroma.Chat
   alias Pleroma.Chat.MessageReference
+  alias Pleroma.FollowingRelationship
   alias Pleroma.Notification
   alias Pleroma.Object
   alias Pleroma.Repo
@@ -20,6 +22,84 @@ defmodule Pleroma.Web.ActivityPub.SideEffects do
 
   def handle(object, meta \\ [])
 
+  # Tasks this handle
+  # - Follows if possible
+  # - Sends a notification
+  # - Generates accept or reject if appropriate
+  def handle(
+        %{
+          data: %{
+            "id" => follow_id,
+            "type" => "Follow",
+            "object" => followed_user,
+            "actor" => following_user
+          }
+        } = object,
+        meta
+      ) do
+    with %User{} = follower <- User.get_cached_by_ap_id(following_user),
+         %User{} = followed <- User.get_cached_by_ap_id(followed_user),
+         {_, {:ok, _}, _, _} <-
+           {:following, User.follow(follower, followed, :follow_pending), follower, followed} do
+      if followed.local && !followed.locked do
+        Utils.update_follow_state_for_all(object, "accept")
+        FollowingRelationship.update(follower, followed, :follow_accept)
+        User.update_follower_count(followed)
+        User.update_following_count(follower)
+
+        %{
+          to: [following_user],
+          actor: followed,
+          object: follow_id,
+          local: true
+        }
+        |> ActivityPub.accept()
+      end
+    else
+      {:following, {:error, _}, follower, followed} ->
+        Utils.update_follow_state_for_all(object, "reject")
+        FollowingRelationship.update(follower, followed, :follow_reject)
+
+        if followed.local do
+          %{
+            to: [follower.ap_id],
+            actor: followed,
+            object: follow_id,
+            local: true
+          }
+          |> ActivityPub.reject()
+        end
+
+      _ ->
+        nil
+    end
+
+    {:ok, notifications} = Notification.create_notifications(object, do_send: false)
+
+    meta =
+      meta
+      |> add_notifications(notifications)
+
+    updated_object = Activity.get_by_ap_id(follow_id)
+
+    {:ok, updated_object, meta}
+  end
+
+  # Tasks this handles:
+  # - Unfollow and block
+  def handle(
+        %{data: %{"type" => "Block", "object" => blocked_user, "actor" => blocking_user}} =
+          object,
+        meta
+      ) do
+    with %User{} = blocker <- User.get_cached_by_ap_id(blocking_user),
+         %User{} = blocked <- User.get_cached_by_ap_id(blocked_user) do
+      User.block(blocker, blocked)
+    end
+
+    {:ok, object, meta}
+  end
+
   # Tasks this handles:
   # - Update the user
   #
@@ -82,7 +162,10 @@ defmodule Pleroma.Web.ActivityPub.SideEffects do
 
     if !User.is_internal_user?(user) do
       Notification.create_notifications(object)
-      ActivityPub.stream_out(object)
+
+      object
+      |> Topics.get_activity_topics()
+      |> Streamer.stream(object)
     end
 
     {:ok, object, meta}
@@ -190,14 +273,20 @@ defmodule Pleroma.Web.ActivityPub.SideEffects do
     {:ok, object}
   end
 
-  def handle_undoing(%{data: %{"type" => "Like"}} = object) do
+  defp undo_like(nil, object), do: delete_object(object)
-    with %Object{} = liked_object <- Object.get_by_ap_id(object.data["object"]),
+
-         {:ok, _} <- Utils.remove_like_from_object(object, liked_object),
+  defp undo_like(%Object{} = liked_object, object) do
-         {:ok, _} <- Repo.delete(object) do
+    with {:ok, _} <- Utils.remove_like_from_object(object, liked_object) do
-      :ok
+      delete_object(object)
     end
   end
 
+  def handle_undoing(%{data: %{"type" => "Like"}} = object) do
+    object.data["object"]
+    |> Object.get_by_ap_id()
+    |> undo_like(object)
+  end
+
   def handle_undoing(%{data: %{"type" => "EmojiReact"}} = object) do
     with %Object{} = reacted_object <- Object.get_by_ap_id(object.data["object"]),
          {:ok, _} <- Utils.remove_emoji_reaction_from_object(object, reacted_object),
@@ -227,6 +316,11 @@ defmodule Pleroma.Web.ActivityPub.SideEffects do
 
   def handle_undoing(object), do: {:error, ["don't know how to handle", object]}
 
+  @spec delete_object(Object.t()) :: :ok | {:error, Ecto.Changeset.t()}
+  defp delete_object(object) do
+    with {:ok, _} <- Repo.delete(object), do: :ok
+  end
+
   defp send_notifications(meta) do
     Keyword.get(meta, :notifications, [])
     |> Enum.each(fn notification ->

lib/pleroma/web/activity_pub/transmogrifier.ex

@@ -62,15 +62,17 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
   def fix_summary(object), do: Map.put(object, "summary", "")
 
   def fix_addressing_list(map, field) do
-    cond do
+    addrs = map[field]
-      is_binary(map[field]) ->
-        Map.put(map, field, [map[field]])
 
-      is_nil(map[field]) ->
+    cond do
-        Map.put(map, field, [])
+      is_list(addrs) ->
+        Map.put(map, field, Enum.filter(addrs, &is_binary/1))
+
+      is_binary(addrs) ->
+        Map.put(map, field, [addrs])
 
       true ->
-        map
+        Map.put(map, field, [])
     end
   end
 
@@ -233,8 +235,10 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
             is_map(url) && is_binary(url["href"]) -> url["href"]
             is_binary(data["url"]) -> data["url"]
             is_binary(data["href"]) -> data["href"]
+            true -> nil
           end
 
+        if href do
           attachment_url =
             %{"href" => href}
             |> Maps.put_if_present("mediaType", media_type)
@@ -244,7 +248,11 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
           |> Maps.put_if_present("mediaType", media_type)
           |> Maps.put_if_present("type", data["type"])
           |> Maps.put_if_present("name", data["name"])
+        else
+          nil
+        end
       end)
+      |> Enum.filter(& &1)
 
     Map.put(object, "attachment", attachments)
   end
@@ -263,12 +271,18 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
 
   def fix_url(%{"type" => object_type, "url" => url} = object)
       when object_type in ["Video", "Audio"] and is_list(url) do
-    first_element = Enum.at(url, 0)
+    attachment =
+      Enum.find(url, fn x ->
+        media_type = x["mediaType"] || x["mimeType"] || ""
 
-    link_element = Enum.find(url, fn x -> is_map(x) and x["mimeType"] == "text/html" end)
+        is_map(x) and String.starts_with?(media_type, ["audio/", "video/"])
+      end)
+
+    link_element =
+      Enum.find(url, fn x -> is_map(x) and (x["mediaType"] || x["mimeType"]) == "text/html" end)
 
     object
-    |> Map.put("attachment", [first_element])
+    |> Map.put("attachment", [attachment])
     |> Map.put("url", link_element["href"])
   end
 
@@ -446,12 +460,9 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
       when objtype in ["Article", "Event", "Note", "Video", "Page", "Question", "Answer", "Audio"] do
     actor = Containment.get_actor(data)
 
-    data =
-      Map.put(data, "actor", actor)
-      |> fix_addressing
-
     with nil <- Activity.get_create_by_object_ap_id(object["id"]),
-         {:ok, %User{} = user} <- User.get_or_fetch_by_ap_id(data["actor"]) do
+         {:ok, %User{} = user} <- User.get_or_fetch_by_ap_id(actor),
+         data <- Map.put(data, "actor", actor) |> fix_addressing() do
       object = fix_object(object, options)
 
       params = %{
@@ -520,66 +531,6 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
     end
   end
 
-  def handle_incoming(
-        %{"type" => "Follow", "object" => followed, "actor" => follower, "id" => id} = data,
-        _options
-      ) do
-    with %User{local: true} = followed <-
-           User.get_cached_by_ap_id(Containment.get_actor(%{"actor" => followed})),
-         {:ok, %User{} = follower} <-
-           User.get_or_fetch_by_ap_id(Containment.get_actor(%{"actor" => follower})),
-         {:ok, activity} <-
-           ActivityPub.follow(follower, followed, id, false, skip_notify_and_stream: true) do
-      with deny_follow_blocked <- Pleroma.Config.get([:user, :deny_follow_blocked]),
-           {_, false} <- {:user_blocked, User.blocks?(followed, follower) && deny_follow_blocked},
-           {_, false} <- {:user_locked, User.locked?(followed)},
-           {_, {:ok, follower}} <- {:follow, User.follow(follower, followed)},
-           {_, {:ok, _}} <-
-             {:follow_state_update, Utils.update_follow_state_for_all(activity, "accept")},
-           {:ok, _relationship} <-
-             FollowingRelationship.update(follower, followed, :follow_accept) do
-        ActivityPub.accept(%{
-          to: [follower.ap_id],
-          actor: followed,
-          object: data,
-          local: true
-        })
-      else
-        {:user_blocked, true} ->
-          {:ok, _} = Utils.update_follow_state_for_all(activity, "reject")
-          {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject)
-
-          ActivityPub.reject(%{
-            to: [follower.ap_id],
-            actor: followed,
-            object: data,
-            local: true
-          })
-
-        {:follow, {:error, _}} ->
-          {:ok, _} = Utils.update_follow_state_for_all(activity, "reject")
-          {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_reject)
-
-          ActivityPub.reject(%{
-            to: [follower.ap_id],
-            actor: followed,
-            object: data,
-            local: true
-          })
-
-        {:user_locked, true} ->
-          {:ok, _relationship} = FollowingRelationship.update(follower, followed, :follow_pending)
-          :noop
-      end
-
-      ActivityPub.notify_and_stream(activity)
-      {:ok, activity}
-    else
-      _e ->
-        :error
-    end
-  end
-
   def handle_incoming(
         %{"type" => "Accept", "object" => follow_object, "actor" => _actor, "id" => id} = data,
         _options
@@ -673,7 +624,7 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
   end
 
   def handle_incoming(%{"type" => type} = data, _options)
-      when type in ["Like", "EmojiReact", "Announce"] do
+      when type in ~w{Like EmojiReact Announce} do
     with :ok <- ObjectValidator.fetch_actor_and_object(data),
          {:ok, activity, _meta} <-
            Pipeline.common_pipeline(data, local: false) do
@@ -684,9 +635,10 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
   end
 
   def handle_incoming(
-        %{"type" => "Update"} = data,
+        %{"type" => type} = data,
         _options
-      ) do
+      )
+      when type in ~w{Update Block Follow} do
     with {:ok, %User{}} <- ObjectValidator.fetch_actor(data),
          {:ok, activity, _} <- Pipeline.common_pipeline(data, local: false) do
       {:ok, activity}
@@ -765,21 +717,6 @@ defmodule Pleroma.Web.ActivityPub.Transmogrifier do
     end
   end
 
-  def handle_incoming(
-        %{"type" => "Block", "object" => blocked, "actor" => blocker, "id" => id} = _data,
-        _options
-      ) do
-    with %User{local: true} = blocked = User.get_cached_by_ap_id(blocked),
-         {:ok, %User{} = blocker} = User.get_or_fetch_by_ap_id(blocker),
-         {:ok, activity} <- ActivityPub.block(blocker, blocked, id, false) do
-      User.unfollow(blocker, blocked)
-      User.block(blocker, blocked)
-      {:ok, activity}
-    else
-      _e -> :error
-    end
-  end
-
   def handle_incoming(
         %{
           "type" => "Move",

lib/pleroma/web/activity_pub/views/user_view.ex

@@ -81,6 +81,15 @@ defmodule Pleroma.Web.ActivityPub.UserView do
 
     fields = Enum.map(user.fields, &Map.put(&1, "type", "PropertyValue"))
 
+    capabilities =
+      if is_boolean(user.accepts_chat_messages) do
+        %{
+          "acceptsChatMessages" => user.accepts_chat_messages
+        }
+      else
+        %{}
+      end
+
     %{
       "id" => user.ap_id,
       "type" => user.actor_type,
@@ -101,7 +110,8 @@ defmodule Pleroma.Web.ActivityPub.UserView do
       "endpoints" => endpoints,
       "attachment" => fields,
       "tag" => emoji_tags,
-      "discoverable" => user.discoverable
+      "discoverable" => user.discoverable,
+      "capabilities" => capabilities
     }
     |> Map.merge(maybe_make_image(&User.avatar_url/2, "icon", user))
     |> Map.merge(maybe_make_image(&User.banner_url/2, "image", user))

lib/pleroma/web/activity_pub/visibility.ex

@@ -47,6 +47,10 @@ defmodule Pleroma.Web.ActivityPub.Visibility do
   @spec visible_for_user?(Activity.t(), User.t() | nil) :: boolean()
   def visible_for_user?(%{actor: ap_id}, %User{ap_id: ap_id}), do: true
 
+  def visible_for_user?(nil, _), do: false
+
+  def visible_for_user?(%{data: %{"listMessage" => _}}, nil), do: false
+
   def visible_for_user?(%{data: %{"listMessage" => list_ap_id}} = activity, %User{} = user) do
     user.ap_id in activity.data["to"] ||
       list_ap_id
@@ -54,8 +58,6 @@ defmodule Pleroma.Web.ActivityPub.Visibility do
       |> Pleroma.List.member?(user)
   end
 
-  def visible_for_user?(%{data: %{"listMessage" => _}}, nil), do: false
-
   def visible_for_user?(%{local: local} = activity, nil) do
     cfg_key =
       if local,

lib/pleroma/web/admin_api/controllers/admin_api_controller.ex

@@ -206,8 +206,8 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
     end
   end
 
-  def user_show(conn, %{"nickname" => nickname}) do
+  def user_show(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do
-    with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do
+    with %User{} = user <- User.get_cached_by_nickname_or_id(nickname, for: admin) do
       conn
       |> put_view(AccountView)
       |> render("show.json", %{user: user})
@@ -233,11 +233,11 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
     |> render("index.json", %{activities: activities, as: :activity})
   end
 
-  def list_user_statuses(conn, %{"nickname" => nickname} = params) do
+  def list_user_statuses(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname} = params) do
     with_reblogs = params["with_reblogs"] == "true" || params["with_reblogs"] == true
     godmode = params["godmode"] == "true" || params["godmode"] == true
 
-    with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do
+    with %User{} = user <- User.get_cached_by_nickname_or_id(nickname, for: admin) do
       {_, page_size} = page_params(params)
 
       activities =
@@ -526,7 +526,7 @@ defmodule Pleroma.Web.AdminAPI.AdminAPIController do
 
   @doc "Show a given user's credentials"
   def show_user_credentials(%{assigns: %{user: admin}} = conn, %{"nickname" => nickname}) do
-    with %User{} = user <- User.get_cached_by_nickname_or_id(nickname) do
+    with %User{} = user <- User.get_cached_by_nickname_or_id(nickname, for: admin) do
       conn
       |> put_view(AccountView)
       |> render("credentials.json", %{user: user, for: admin})

lib/pleroma/web/admin_api/controllers/config_controller.ex

@@ -9,8 +9,6 @@ defmodule Pleroma.Web.AdminAPI.ConfigController do
   alias Pleroma.ConfigDB
   alias Pleroma.Plugs.OAuthScopesPlug
 
-  @descriptions Pleroma.Docs.JSON.compile()
-
   plug(Pleroma.Web.ApiSpec.CastAndValidate)
   plug(OAuthScopesPlug, %{scopes: ["write"], admin: true} when action == :update)
 
@@ -25,7 +23,7 @@ defmodule Pleroma.Web.AdminAPI.ConfigController do
   defdelegate open_api_operation(action), to: Pleroma.Web.ApiSpec.Admin.ConfigOperation
 
   def descriptions(conn, _params) do
-    descriptions = Enum.filter(@descriptions, &whitelisted_config?/1)
+    descriptions = Enum.filter(Pleroma.Docs.JSON.compiled_descriptions(), &whitelisted_config?/1)
 
     json(conn, descriptions)
   end

lib/pleroma/web/api_spec/cast_and_validate.ex

@@ -40,7 +40,7 @@ defmodule Pleroma.Web.ApiSpec.CastAndValidate do
           |> List.first()
 
         _ ->
-          nil
+          "application/json"
       end
 
     private_data = Map.put(private_data, :operation_id, operation_id)

lib/pleroma/web/api_spec/helpers.ex

@@ -29,6 +29,10 @@ defmodule Pleroma.Web.ApiSpec.Helpers do
     }
   end
 
+  def admin_api_params do
+    [Operation.parameter(:admin_token, :query, :string, "Allows authorization via admin token.")]
+  end
+
   def pagination_params do
     [
       Operation.parameter(:max_id, :query, :string, "Return items older than this ID"),

lib/pleroma/web/api_spec/operations/account_operation.ex

@@ -61,7 +61,7 @@ defmodule Pleroma.Web.ApiSpec.AccountOperation do
       description: "Update the user's display and preferences.",
       operationId: "AccountController.update_credentials",
       security: [%{"oAuth" => ["write:accounts"]}],
-      requestBody: request_body("Parameters", update_creadentials_request(), required: true),
+      requestBody: request_body("Parameters", update_credentials_request(), required: true),
       responses: %{
         200 => Operation.response("Account", "application/json", Account),
         403 => Operation.response("Error", "application/json", ApiError)
@@ -203,14 +203,23 @@ defmodule Pleroma.Web.ApiSpec.AccountOperation do
       security: [%{"oAuth" => ["follow", "write:follows"]}],
       description: "Follow the given account",
       parameters: [
-        %Reference{"$ref": "#/components/parameters/accountIdOrNickname"},
+        %Reference{"$ref": "#/components/parameters/accountIdOrNickname"}
-        Operation.parameter(
-          :reblogs,
-          :query,
-          BooleanLike,
-          "Receive this account's reblogs in home timeline? Defaults to true."
-        )
       ],
+      requestBody:
+        request_body(
+          "Parameters",
+          %Schema{
+            type: :object,
+            properties: %{
+              reblogs: %Schema{
+                type: :boolean,
+                description: "Receive this account's reblogs in home timeline? Defaults to true.",
+                default: true
+              }
+            }
+          },
+          required: false
+        ),
       responses: %{
         200 => Operation.response("Relationship", "application/json", AccountRelationship),
         400 => Operation.response("Error", "application/json", ApiError),
@@ -438,6 +447,7 @@ defmodule Pleroma.Web.ApiSpec.AccountOperation do
     }
   end
 
+  # TODO: This is actually a token respone, but there's no oauth operation file yet.
   defp create_response do
     %Schema{
       title: "AccountCreateResponse",
@@ -446,19 +456,25 @@ defmodule Pleroma.Web.ApiSpec.AccountOperation do
       properties: %{
         token_type: %Schema{type: :string},
         access_token: %Schema{type: :string},
-        scope: %Schema{type: :array, items: %Schema{type: :string}},
+        refresh_token: %Schema{type: :string},
-        created_at: %Schema{type: :integer, format: :"date-time"}
+        scope: %Schema{type: :string},
+        created_at: %Schema{type: :integer, format: :"date-time"},
+        me: %Schema{type: :string},
+        expires_in: %Schema{type: :integer}
       },
       example: %{
+        "token_type" => "Bearer",
         "access_token" => "i9hAVVzGld86Pl5JtLtizKoXVvtTlSCJvwaugCxvZzk",
+        "refresh_token" => "i9hAVVzGld86Pl5JtLtizKoXVvtTlSCJvwaugCxvZzz",
         "created_at" => 1_585_918_714,
-        "scope" => ["read", "write", "follow", "push"],
+        "expires_in" => 600,
-        "token_type" => "Bearer"
+        "scope" => "read write follow push",
+        "me" => "https://gensokyo.2hu/users/raymoo"
       }
     }
   end
 
-  defp update_creadentials_request do
+  defp update_credentials_request do
     %Schema{
       title: "AccountUpdateCredentialsRequest",
       description: "POST body for creating an account",
@@ -492,6 +508,11 @@ defmodule Pleroma.Web.ApiSpec.AccountOperation do
           nullable: true,
           description: "Whether manual approval of follow requests is required."
         },
+        accepts_chat_messages: %Schema{
+          allOf: [BooleanLike],
+          nullable: true,
+          description: "Whether the user accepts receiving chat messages."
+        },
         fields_attributes: %Schema{
           nullable: true,
           oneOf: [

lib/pleroma/web/api_spec/operations/admin/config_operation.ex

@@ -26,6 +26,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ConfigOperation do
           %Schema{type: :boolean, default: false},
           "Get only saved in database settings"
         )
+        | admin_api_params()
       ],
       security: [%{"oAuth" => ["read"]}],
       responses: %{
@@ -41,6 +42,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ConfigOperation do
       summary: "Update config settings",
       operationId: "AdminAPI.ConfigController.update",
       security: [%{"oAuth" => ["write"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -73,6 +75,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ConfigOperation do
       summary: "Get JSON with config descriptions.",
       operationId: "AdminAPI.ConfigController.descriptions",
       security: [%{"oAuth" => ["read"]}],
+      parameters: admin_api_params(),
       responses: %{
         200 =>
           Operation.response("Config Descriptions", "application/json", %Schema{

lib/pleroma/web/api_spec/operations/admin/invite_operation.ex

@@ -20,6 +20,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.InviteOperation do
       summary: "Get a list of generated invites",
       operationId: "AdminAPI.InviteController.index",
       security: [%{"oAuth" => ["read:invites"]}],
+      parameters: admin_api_params(),
       responses: %{
         200 =>
           Operation.response("Invites", "application/json", %Schema{
@@ -51,6 +52,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.InviteOperation do
       summary: "Create an account registration invite token",
       operationId: "AdminAPI.InviteController.create",
       security: [%{"oAuth" => ["write:invites"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -71,6 +73,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.InviteOperation do
       summary: "Revoke invite by token",
       operationId: "AdminAPI.InviteController.revoke",
       security: [%{"oAuth" => ["write:invites"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",
@@ -97,6 +100,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.InviteOperation do
       summary: "Sends registration invite via email",
       operationId: "AdminAPI.InviteController.email",
       security: [%{"oAuth" => ["write:invites"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",

lib/pleroma/web/api_spec/operations/admin/media_proxy_cache_operation.ex

@@ -33,6 +33,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.MediaProxyCacheOperation do
           %Schema{type: :integer, default: 50},
           "Number of statuses to return"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 => success_response()
@@ -46,6 +47,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.MediaProxyCacheOperation do
       summary: "Remove a banned MediaProxy URL from Cachex",
       operationId: "AdminAPI.MediaProxyCacheController.delete",
       security: [%{"oAuth" => ["write:media_proxy_caches"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",
@@ -71,6 +73,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.MediaProxyCacheOperation do
       summary: "Purge and optionally ban a MediaProxy URL",
       operationId: "AdminAPI.MediaProxyCacheController.purge",
       security: [%{"oAuth" => ["write:media_proxy_caches"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body(
           "Parameters",

lib/pleroma/web/api_spec/operations/admin/oauth_app_operation.ex

@@ -36,6 +36,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.OAuthAppOperation do
           %Schema{type: :integer, default: 50},
           "Number of apps to return"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 =>
@@ -72,6 +73,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.OAuthAppOperation do
       summary: "Create OAuth App",
       operationId: "AdminAPI.OAuthAppController.create",
       requestBody: request_body("Parameters", create_request()),
+      parameters: admin_api_params(),
       security: [%{"oAuth" => ["write"]}],
       responses: %{
         200 => Operation.response("App", "application/json", oauth_app()),
@@ -85,7 +87,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.OAuthAppOperation do
       tags: ["Admin", "oAuth Apps"],
       summary: "Update OAuth App",
       operationId: "AdminAPI.OAuthAppController.update",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write"]}],
       requestBody: request_body("Parameters", update_request()),
       responses: %{
@@ -103,7 +105,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.OAuthAppOperation do
       tags: ["Admin", "oAuth Apps"],
       summary: "Delete OAuth App",
       operationId: "AdminAPI.OAuthAppController.delete",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write"]}],
       responses: %{
         204 => no_content_response(),

lib/pleroma/web/api_spec/operations/admin/relay_operation.ex

@@ -19,6 +19,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.RelayOperation do
       summary: "List Relays",
       operationId: "AdminAPI.RelayController.index",
       security: [%{"oAuth" => ["read"]}],
+      parameters: admin_api_params(),
       responses: %{
         200 =>
           Operation.response("Response", "application/json", %Schema{
@@ -41,6 +42,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.RelayOperation do
       summary: "Follow a Relay",
       operationId: "AdminAPI.RelayController.follow",
       security: [%{"oAuth" => ["write:follows"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -64,6 +66,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.RelayOperation do
       summary: "Unfollow a Relay",
       operationId: "AdminAPI.RelayController.unfollow",
       security: [%{"oAuth" => ["write:follows"]}],
+      parameters: admin_api_params(),
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,

lib/pleroma/web/api_spec/operations/admin/report_operation.ex

@@ -48,6 +48,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ReportOperation do
           %Schema{type: :integer, default: 50},
           "Number number of log entries per page"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 =>
@@ -71,7 +72,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ReportOperation do
       tags: ["Admin", "Reports"],
       summary: "Get an individual report",
       operationId: "AdminAPI.ReportController.show",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["read:reports"]}],
       responses: %{
         200 => Operation.response("Report", "application/json", report()),
@@ -86,6 +87,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ReportOperation do
       summary: "Change the state of one or multiple reports",
       operationId: "AdminAPI.ReportController.update",
       security: [%{"oAuth" => ["write:reports"]}],
+      parameters: admin_api_params(),
       requestBody: request_body("Parameters", update_request(), required: true),
       responses: %{
         204 => no_content_response(),
@@ -100,7 +102,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ReportOperation do
       tags: ["Admin", "Reports"],
       summary: "Create report note",
       operationId: "AdminAPI.ReportController.notes_create",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       requestBody:
         request_body("Parameters", %Schema{
           type: :object,
@@ -124,6 +126,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.ReportOperation do
       parameters: [
         Operation.parameter(:report_id, :path, :string, "Report ID"),
         Operation.parameter(:id, :path, :string, "Note ID")
+        | admin_api_params()
       ],
       security: [%{"oAuth" => ["write:reports"]}],
       responses: %{

lib/pleroma/web/api_spec/operations/admin/status_operation.ex

@@ -55,6 +55,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.StatusOperation do
           %Schema{type: :integer, default: 50},
           "Number of statuses to return"
         )
+        | admin_api_params()
       ],
       responses: %{
         200 =>
@@ -71,7 +72,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.StatusOperation do
       tags: ["Admin", "Statuses"],
       summary: "Show Status",
       operationId: "AdminAPI.StatusController.show",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["read:statuses"]}],
       responses: %{
         200 => Operation.response("Status", "application/json", status()),
@@ -85,7 +86,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.StatusOperation do
       tags: ["Admin", "Statuses"],
       summary: "Change the scope of an individual reported status",
       operationId: "AdminAPI.StatusController.update",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write:statuses"]}],
       requestBody: request_body("Parameters", update_request(), required: true),
       responses: %{
@@ -100,7 +101,7 @@ defmodule Pleroma.Web.ApiSpec.Admin.StatusOperation do
       tags: ["Admin", "Statuses"],
       summary: "Delete an individual reported status",
       operationId: "AdminAPI.StatusController.delete",
-      parameters: [id_param()],
+      parameters: [id_param() | admin_api_params()],
       security: [%{"oAuth" => ["write:statuses"]}],
       responses: %{
         200 => empty_object_response(),